| Company Name: |
Nanjing Joyin Pharmachem Co.,Ltd Gold
|
| Tel: |
025-84670162-814 17354973727 |
| Email: |
marketing@joyin.cc |
| Products Intro: |
Product Name:Benzonitrile, 3-[[2,3-dihydro-7-(methylthio)-1-oxo-1H-inden-4-yl]oxy]-5-fluoro- CAS:1672665-69-8 Purity:98% Package:5KG;25KG
|
| Company Name: |
Suzhou Zehou Biotechnology Co. , Ltd.
|
| Tel: |
0512-68716880 19984816880 |
| Email: |
sales@growingchem.com |
| Products Intro: |
Product Name:3-Fluoro-5-((7-(methylthio)-1-oxo-2,3-dihydro-1H-inden-4-yl)oxy)benzonitrile CAS:1672665-69-8 Purity:98% Package:1g;5g;10g
|
| Company Name: |
Haoyuan Chemexpress Co., Ltd.
|
| Tel: |
021-58950125 |
| Email: |
info@chemexpress.com |
| Products Intro: |
Product Name:Benzonitrile, 3-[[2,3-dihydro-7-(methylthio)-1-oxo-1H-inden-4-yl]oxy]-5-fluoro- CAS:1672665-69-8 Purity:>98% Package:25000RMB/500mg
|
| Company Name: |
ShangHai Caerulum Pharma Discovery Co., Ltd.
|
| Tel: |
18149758185 |
| Email: |
sales-cpd@caerulumpharma.com |
| Products Intro: |
Product Name:3-Fluoro-5-((7-(methylthio)-1-oxo-2,3-dihydro-1H-inden-4-yl)oxy)benzonitrile CAS:1672665-69-8 Purity:98% Package:1g;10g;100g
|
Benzonitrile, 3-[[2,3-dihydro-7-(methylthio)-1-oxo-1H-inden-4-yl]oxy]-5-fluoro- manufacturers
|
| | Benzonitrile, 3-[[2,3-dihydro-7-(methylthio)-1-oxo-1H-inden-4-yl]oxy]-5-fluoro- Basic information |
| | Benzonitrile, 3-[[2,3-dihydro-7-(methylthio)-1-oxo-1H-inden-4-yl]oxy]-5-fluoro- Chemical Properties |
| Boiling point | 447.2±45.0 °C(Predicted) | | density | 1.38±0.1 g/cm3(Predicted) | | InChI | InChI=1S/C17H12FNO2S/c1-22-16-5-4-15(13-2-3-14(20)17(13)16)21-12-7-10(9-19)6-11(18)8-12/h4-8H,2-3H2,1H3 | | InChIKey | DQLHLJOHRHEPQS-UHFFFAOYSA-N | | SMILES | C(#N)C1=CC(F)=CC(OC2=CC=C(SC)C3=C2CCC3=O)=C1 |
| | Benzonitrile, 3-[[2,3-dihydro-7-(methylthio)-1-oxo-1H-inden-4-yl]oxy]-5-fluoro- Usage And Synthesis |
| | Benzonitrile, 3-[[2,3-dihydro-7-(methylthio)-1-oxo-1H-inden-4-yl]oxy]-5-fluoro- Preparation Products And Raw materials |
|