| Company Name: |
ChemStrong Scientific Co.,Ltd
|
| Tel: |
0755-0755-66853366 13670046396 |
| Email: |
sales@chem-strong.com |
| Products Intro: |
Product Name:Melphalan EP Impurity B
CAS:1270153-04-2
Purity:95% HPLC Package:10mg;25mg;50mg;100mg
|
|
| | Melphalan Impurity B Basic information |
| Product Name: | Melphalan Impurity B | | Synonyms: | Melphalan Impurity B;(2S)-2-Amino-3-(4-morpholin-4-ylphenyl)propanoic Acid;Melphalan EP impurity B;Melphalan Impurity 2(Melphalan EP Impurity B);Melphalan EP Impurity B Di HCl salt;L-Phenylalanine, 4-(4-morpholinyl)-;4-(4-Morpholinyl)-L-phenylalanine;4-Morpholin-4-yl-L-phenylalanine | | CAS: | 1270153-04-2 | | MF: | C13H18N2O3 | | MW: | 250.29 | | EINECS: | | | Product Categories: | | | Mol File: | 1270153-04-2.mol |  |
| | Melphalan Impurity B Chemical Properties |
| Melting point | >214°C (dec.) | | Boiling point | 463.4±45.0 °C(Predicted) | | density | 1.246±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator, under inert atmosphere | | solubility | Acidic Methanol (Slightly), DMSO (Slightly, Heated), Water (Slightly, Sonicated) | | form | Solid | | pka | 2.12±0.10(Predicted) | | color | White to Off-White | | InChI | InChI=1S/C13H18N2O3/c14-12(13(16)17)9-10-1-3-11(4-2-10)15-5-7-18-8-6-15/h1-4,12H,5-9,14H2,(H,16,17)/t12-/m0/s1 | | InChIKey | BKFTZFXJLYAYLN-LBPRGKRZSA-N | | SMILES | C(O)(=O)[C@H](CC1=CC=C(N2CCOCC2)C=C1)N |
| | Melphalan Impurity B Usage And Synthesis |
| Uses | (2S)-2-Amino-3-(4-morpholin-4-ylphenyl)propanoic Acid is a possible impurity of Melphalan (M216900) which is an antineoplastic. |
| | Melphalan Impurity B Preparation Products And Raw materials |
|