- Simendan
-
-
2026-07-13
- CAS:131741-08-7
- Min. Order: 1g
- Purity: More Than 99%
- Supply Ability: 100kg/Month
- Simendan
-
- $1.00
-
2019-08-30
- CAS:131741-08-7
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 200kg
- Simendan
-
- $1.00
-
2019-05-22
- CAS:131741-08-7
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 500KG
|
| | Simendan Basic information |
| Product Name: | Simendan | | Synonyms: | 2-[[4-(4-methyl-6-oxo-4,5-dihydro-1h-pyridazin-3-yl)phenyl]hydrazinylidene]propanedinitrile;((4-(1,4,5,6-tetrahydro-4-methyl-6-oxo-3-pyridazinyl)phenyl)hydrazono)propanedinitrile;simendan;simendan R--[4-(1,4,5,6-Tetrahydro-4-methyl-6-oxo-3-pyridazinyl)phenyl] hydrozono]-propanedinitrile;R-(-)-4-(1,4,5,6-tetrahydro-4-methyl-6-oxo-3-pyridazinyl)phenyl hydrozono-propanedinitrile;LEVOFLUOROCARBOXYLICACID;2-[[4-(6-keto-4-methyl-4,5-dihydro-1H-pyridazin-3-yl)phenyl]hydrazono]malononitrile;Propanedinitrile,2-[2-[4-(1,4,5,6-tetrahydro-4-Methyl-6-oxo-3-pyridazinyl)phenyl]hydrazinylidene]- | | CAS: | 131741-08-7 | | MF: | C14H12N6O | | MW: | 280.28 | | EINECS: | | | Product Categories: | | | Mol File: | 131741-08-7.mol |  |
| | Simendan Chemical Properties |
| Melting point | >238°C (dec.) | | density | 1.33±0.1 g/cm3(Predicted) | | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | | solubility | DMSO (Slightly), THF (Slightly, Sonicated) | | pka | 6.12±0.10(Predicted) | | form | Solid | | color | Yellow to Dark Yellow | | InChI | InChI=1S/C14H12N6O/c1-9-6-13(21)19-20-14(9)10-2-4-11(5-3-10)17-18-12(7-15)8-16/h2-5,9,17H,6H2,1H3,(H,19,21) | | InChIKey | WHXMKTBCFHIYNQ-UHFFFAOYSA-N | | SMILES | C(#N)/C(=N/NC1=CC=C(C2=NNC(=O)CC2C)C=C1)/C#N | | CAS DataBase Reference | 131741-08-7(CAS DataBase Reference) |
| | Simendan Usage And Synthesis |
| Uses | Simendan is the racemic mixture of Levosimendan (L378000) which is a positive inotropic agent with vasodilating activity. |
| | Simendan Preparation Products And Raw materials |
|