|
|
| | Lactic acid isoamyl ester Basic information |
| Product Name: | Lactic acid isoamyl ester | | Synonyms: | Propanoic acid, 2-hydroxy-, 3-methylbutyl ester;2-Hydroxypropionic acid isopentyl ester;3-Methylbutyl lactate;Einecs 242-966-8;Lactic Acid Isoamyl Ester
Isopentyl Lactate;Isopentyl 2-hydroxypropanoate;lacticacidisopentylester;ISOPENTYL LACTATE | | CAS: | 19329-89-6 | | MF: | C8H16O3 | | MW: | 160.21 | | EINECS: | 242-966-8 | | Product Categories: | | | Mol File: | 19329-89-6.mol |  |
| | Lactic acid isoamyl ester Chemical Properties |
| Boiling point | 202 °C | | density | 0.96 | | refractive index | 1.4220-1.4250 | | storage temp. | Store at room temperature | | pka | 13.06±0.20(Predicted) | | form | clear liquid | | color | Colorless to Almost colorless | | Odor | at 100.00 %. fruity creamy nutty | | Odor Type | fruity | | InChI | InChI=1S/C8H16O3/c1-6(2)4-5-11-8(10)7(3)9/h6-7,9H,4-5H2,1-3H3 | | InChIKey | CRORGGSWAKIXSA-UHFFFAOYSA-N | | SMILES | C(OCCC(C)C)(=O)C(O)C | | LogP | 1.333 (est) | | CAS DataBase Reference | 19329-89-6(CAS DataBase Reference) | | EPA Substance Registry System | Isoamyl lactate (19329-89-6) |
| | Lactic acid isoamyl ester Usage And Synthesis |
| Definition | ChEBI: A carboxylic ester obtained by the formal condensation of the carboxy group of 2-hydroxypropanoic acid with the hydroxy group of isoamylol. |
| | Lactic acid isoamyl ester Preparation Products And Raw materials |
|