|
|
| | trans,trans-2,4-Undecadienal Basic information |
| Product Name: | trans,trans-2,4-Undecadienal | | Synonyms: | TRANS,TRANS-2,4-UNDECADIEN-1-AL;TRANS, TRANS-2,4-UNDECADIENAL;(2E,4E)-2,4-Undecadienal;(E,E)-2,4-Undecadien-1-al;(E,E)-2,4-Undecanal;(e,e)-4-undecadienal;BroMoridane HydrobroMide;(E,E)-undeca-2,4-dienal | | CAS: | 30361-29-6 | | MF: | C11H18O | | MW: | 166.26 | | EINECS: | 250-148-7 | | Product Categories: | Alphabetical Listings;Flavors and Fragrances;Q-Z;Aromatics;Heterocycles;Isotope Labelled Compounds | | Mol File: | 30361-29-6.mol |  |
| | trans,trans-2,4-Undecadienal Chemical Properties |
| Melting point | 170-172°C | | Boiling point | 128-129°C 10mm | | density | 0.869 g/mL at 25 °C(lit.) | | FEMA | 3422 | 2,4-UNDECADIENAL | | refractive index | n20/D 1.514(lit.) | | Fp | >230 °F | | storage temp. | Hygroscopic, -20°C Freezer, Under Inert Atmosphere | | solubility | DMSO, Methanol | | form | Solid | | color | White to Off-White | | Odor | at 1.00 % in dipropylene glycol. oily caramellic spicy citrus buttery baked | | Odor Type | green | | biological source | synthetic | | Sensitive | Air Sensitive | | BRN | 1706330 | | Major Application | flavors and fragrances | | Cosmetics Ingredients Functions | PERFUMING | | InChI | 1S/C11H18O/c1-2-3-4-5-6-7-8-9-10-11-12/h7-11H,2-6H2,1H3/b8-7+,10-9+ | | InChIKey | UVIUIIFPIWRILL-XBLVEGMJSA-N | | SMILES | [H]C(=O)\C([H])=C([H])\C([H])=C(/[H])CCCCCC | | LogP | 3.71 | | CAS DataBase Reference | 30361-29-6(CAS DataBase Reference) | | NIST Chemistry Reference | 2,4-Undecadienal, (e,e)-(30361-29-6) | | EPA Substance Registry System | 2,4-Undecadienal, (2E,4E)- (30361-29-6) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29121900 | | Storage Class | 10 - Combustible liquids |
| | trans,trans-2,4-Undecadienal Usage And Synthesis |
| Chemical Properties | Off-White Solid | | Uses | An intermediate for the synthesis of mivacurium | | Definition | ChEBI: 2,4-Undecadienal is a fatty aldehyde. | | Synthesis Reference(s) | The Journal of Organic Chemistry, 55, p. 3679, 1990 DOI: 10.1021/jo00298a061 |
| | trans,trans-2,4-Undecadienal Preparation Products And Raw materials |
|