| Company Name: |
Yurui (Shanghai) Chemical Co., Ltd.
|
| Tel: |
+86-02150456736 +86-18602143071 |
| Email: |
xin@riyngroup.com |
| Products Intro: |
Product Name:9H-Carbazole, 3,3'-(1,6-pyrenediyl)bis[9-phenyl- CAS:1243541-83-4 Purity:98% Package:50G;100G Remarks:86g
|
| Company Name: |
Zhengzhou Huiju Chemical Co., Ltd.
|
| Tel: |
0371-55900031 18137872243 |
| Email: |
2853979815@qq.com |
| Products Intro: |
Product Name:9H-Carbazole, 3,3'-(1,6-pyrenediyl)bis[9-phenyl- CAS:1243541-83-4 Purity:98% Package:1g ;5g ;10g ;25g ;100g ;500g ;1kg ;5kg
|
| Company Name: |
Springchem New Material Technology Co.,Ltd
|
| Tel: |
021-52836897 13917661608 |
| Email: |
info@spring-chem.com |
| Products Intro: |
Product Name:9H-Carbazole, 3,3'-(1,6-pyrenediyl)bis[9-phenyl- CAS:1243541-83-4 Purity:98%, 99% Package:500g,1kg,5kg,10kg
|
|
| | 9H-Carbazole, 3,3'-(1,6-pyrenediyl)bis[9-phenyl- Basic information |
| | 9H-Carbazole, 3,3'-(1,6-pyrenediyl)bis[9-phenyl- Chemical Properties |
| InChIKey | KVUPKIISWJBOQR-UHFFFAOYSA-N | | SMILES | C1(C2=CC3C4=C(N(C5=CC=CC=C5)C=3C=C2)C=CC=C4)=C2C3=C4C(C=C2)=CC=C(C2=CC5C6=C(N(C7=CC=CC=C7)C=5C=C2)C=CC=C6)C4=CC=C3C=C1 |
| | 9H-Carbazole, 3,3'-(1,6-pyrenediyl)bis[9-phenyl- Usage And Synthesis |
| | 9H-Carbazole, 3,3'-(1,6-pyrenediyl)bis[9-phenyl- Preparation Products And Raw materials |
|