| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:3-(4-Azidophenyl)propionic acid
CAS:103489-31-2
Purity:>=97.0% (T) Package:1G,250MG
|
|
| | 3-(4-AZIDOPHENYL)PROPIONIC ACID Basic information |
| Product Name: | 3-(4-AZIDOPHENYL)PROPIONIC ACID | | Synonyms: | 3-(4-AZIDOPHENYL)PROPIONIC ACID;3-(4-Azidophenyl)propionic acid >=97.0% (T);3-(4-Azidophenyl)propionic acid≥ 99% (TLC);3-(4-azidophenyl)propanoic acid;3-(4-Azidophenyl)propanoicaci | | CAS: | 103489-31-2 | | MF: | C9H9N3O2 | | MW: | 191.19 | | EINECS: | | | Product Categories: | | | Mol File: | 103489-31-2.mol |  |
| | 3-(4-AZIDOPHENYL)PROPIONIC ACID Chemical Properties |
| Melting point | 106-107 °C | | storage temp. | 2-8°C | | form | powder | | BRN | 4424312 | | InChI | 1S/C9H9N3O2/c10-12-11-8-4-1-7(2-5-8)3-6-9(13)14/h1-2,4-5H,3,6H2,(H,13,14) | | InChIKey | RZYXFEOBOVVBLL-UHFFFAOYSA-N | | SMILES | OC(=O)CCc1ccc(cc1)N=[N+]=[N-] |
| Hazard Codes | E | | Risk Statements | 2-11-36/37/38 | | Safety Statements | 26-35 | | RIDADR | UN1325 - class 4.1 - PG 2 - Flammable solids, organic, n.o.s., HI: all | | WGK Germany | 3 | | Storage Class | 4.1B - Flammable solid hazardous materials | | Hazard Classifications | Eye Irrit. 2
Flam. Sol. 1
Skin Irrit. 2
STOT SE 3 |
| | 3-(4-AZIDOPHENYL)PROPIONIC ACID Usage And Synthesis |
| Chemical Properties | Off-white to yellow powder | | reaction suitability | reaction type: click chemistry |
| | 3-(4-AZIDOPHENYL)PROPIONIC ACID Preparation Products And Raw materials |
|