(1R,5S)-3-ethyl-Bicyclo[3.2.0]hept-3-en-6-one manufacturers
|
| | (1R,5S)-3-ethyl-Bicyclo[3.2.0]hept-3-en-6-one Basic information | | Uses |
| Product Name: | (1R,5S)-3-ethyl-Bicyclo[3.2.0]hept-3-en-6-one | | Synonyms: | (1R,5S)-3-ethyl-Bicyclo[3.2.0]hept-3-en-6-one ISO 9001:2015 REACH;Bicyclo[3.2.0]hept-3-en-6-one, 3-ethyl-, (1R,5S);Mirogabalin Intermediate;(1R,5S)-3-ethyl-Bicyclo[3.2.0]hept-3-en-6-one;MRIO-010;Mirogabalin Intermediate 1;Mirogabalin Impurity 4;Mirogabalin Impurity 16 | | CAS: | 1235479-61-4 | | MF: | C9H12O | | MW: | 136.19 | | EINECS: | | | Product Categories: | | | Mol File: | 1235479-61-4.mol | ![(1R,5S)-3-ethyl-Bicyclo[3.2.0]hept-3-en-6-one Structure](CAS/20180601/GIF/1235479-61-4.gif) |
| | (1R,5S)-3-ethyl-Bicyclo[3.2.0]hept-3-en-6-one Chemical Properties |
| Boiling point | 212.5±9.0 °C(Predicted) | | density | 1.043±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C9H12O/c1-2-6-3-7-5-9(10)8(7)4-6/h4,7-8H,2-3,5H2,1H3/t7-,8-/m1/s1 | | InChIKey | QEGONAXSXKFDLY-HTQZYQBOSA-N | | SMILES | [C@]12([H])[C@]([H])(C(=O)C1)C=C(CC)C2 |
| | (1R,5S)-3-ethyl-Bicyclo[3.2.0]hept-3-en-6-one Usage And Synthesis |
| Uses | Mirobalin DB01, an important pharmaceutical intermediate, is primarily used in the preparation of miruggabalin. Meruggabalin is a calcium channel modulator mainly used to treat chronic pain and other related diseases. As a key intermediate in the synthesis of miruggabalin, the quality and purity of mirobalin DB01 directly affect the efficacy and safety of the final product. Furthermore, mirobalin DB01 can also be used in the synthesis and preparation of other drugs as an important raw material or excipient. Its application prospects in the pharmaceutical field are broad, providing strong support for the treatment of various diseases. |
| | (1R,5S)-3-ethyl-Bicyclo[3.2.0]hept-3-en-6-one Preparation Products And Raw materials |
|