|
| 4-Fluoro-3-(trifluoromethyl)phenol Basic information |
| 4-Fluoro-3-(trifluoromethyl)phenol Chemical Properties |
Melting point | 17 °C | Boiling point | 84-86°C 15mm | density | 1.145 | refractive index | 1.45 | Fp | 90°C | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | form | powder to lump to clear liquid | pka | 8.97±0.18(Predicted) | color | White or Colorless to Orange to Green | BRN | 2098736 | InChI | InChI=1S/C7H4F4O/c8-6-2-1-4(12)3-5(6)7(9,10)11/h1-3,12H | InChIKey | DHPCRFYUUWAGAH-UHFFFAOYSA-N | SMILES | C1(O)=CC=C(F)C(C(F)(F)F)=C1 | CAS DataBase Reference | 61721-07-1(CAS DataBase Reference) |
| 4-Fluoro-3-(trifluoromethyl)phenol Usage And Synthesis |
Chemical Properties | Colorless to pale yellow liquid | Uses | 4-Fluoro-3-trifluoromethylphenol |
| 4-Fluoro-3-(trifluoromethyl)phenol Preparation Products And Raw materials |
|