|
|
| | 4-(CHLOROMETHYL)-3,5-DIMETHYLISOXAZOLE Basic information |
| | 4-(CHLOROMETHYL)-3,5-DIMETHYLISOXAZOLE Chemical Properties |
| Melting point | 88-90°C | | Boiling point | 87-88 °C/8 mmHg (lit.) | | density | 1.173 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.486(lit.) | | Fp | 204 °F | | storage temp. | 2-8°C | | form | clear liquid | | pka | -1.73±0.28(Predicted) | | color | Light yellow to Brown | | BRN | 110780 | | InChI | InChI=1S/C6H8ClNO/c1-4-6(3-7)5(2)9-8-4/h3H2,1-2H3 | | InChIKey | NIFAUKBQIAURIM-UHFFFAOYSA-N | | SMILES | O1C(C)=C(CCl)C(C)=N1 | | CAS DataBase Reference | 19788-37-5(CAS DataBase Reference) | | EPA Substance Registry System | Isoxazole, 4-(chloromethyl)-3,5-dimethyl- (19788-37-5) |
| Hazard Codes | Xn,Xi | | Risk Statements | 20/21/22-36/37/38-37/38-36 | | Safety Statements | 26-36 | | RIDADR | UN 3334 | | WGK Germany | 3 | | TSCA | TSCA listed | | HazardClass | IRRITANT | | HS Code | 29349990 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 4-(CHLOROMETHYL)-3,5-DIMETHYLISOXAZOLE Usage And Synthesis |
| Chemical Properties | Colorless to yellow liquid | | Uses | 4-Chloromethyl-3,5-dimethylisoxazole has been used in the preparation of:
- 4(3-oxoalkyl)isoxazole
- (E)-3,5-dimethyl-4-(2-(thiophene-3-yl)vinyl)isoxazole
| | Application | 4-(Chloromethyl)-3,5-dimethylisoxazole is an annulation reagent used for the construction of cyclohexenones in the syntheses of steroids, terpenes, and alkaloids. | | General Description | 4-Chloromethyl-3,5-dimethylisoxazole participates in asymmetric isoxazole annulation reaction. | | storage |
Handling, Storage, and Precautions of 4-(Chloromethyl)-3,5-dimethylisoxazole: light-sensitive lachrymator; refrigerate; handle and store under
nitrogen.
|
| | 4-(CHLOROMETHYL)-3,5-DIMETHYLISOXAZOLE Preparation Products And Raw materials |
|