- Ethyldiphenylphosphine
-
- $1.00 / 1KG
-
2025-12-12
- CAS:607-01-2
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20 tons
|
| | ETHYLDIPHENYLPHOSPHINE Basic information |
| | ETHYLDIPHENYLPHOSPHINE Chemical Properties |
| Boiling point | 293 °C(lit.) | | density | 1.048 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.614(lit.) | | Fp | >230 °F | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | Liquid | | color | Clear colorless | | Specific Gravity | 1.048 | | Sensitive | Air Sensitive | | BRN | 744253 | | InChI | InChI=1S/C14H15P/c1-2-15(13-9-5-3-6-10-13)14-11-7-4-8-12-14/h3-12H,2H2,1H3 | | InChIKey | WUOIAOOSKMHJOV-UHFFFAOYSA-N | | SMILES | P(CC)(C1=CC=CC=C1)C1=CC=CC=C1 | | CAS DataBase Reference | 607-01-2(CAS DataBase Reference) | | EPA Substance Registry System | Phosphine, ethyldiphenyl- (607-01-2) |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26-36 | | RIDADR | 3278 | | WGK Germany | 3 | | RTECS | SY9242500 | | F | 10-13-23 | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29310099 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | ETHYLDIPHENYLPHOSPHINE Usage And Synthesis |
| Chemical Properties | clear colorless liquid | | Uses | Catalyst for:
- Three component coupling reactions of arylaldehydes with Me vinyl ketone and phthalimide
- Regio- and stereoselective hydroalkynylation of methylenecyclopropanes
- Synthesis of oxazolidines, thiazolidines, pyrrolidines, and indoles
- Dimer to monomer conversion
- Tandem Morita-Baylis-Hillman/Michael addition reactions
- Platinum-catalyzed cyclization
- Regioselective and stereoselective [3+2] cycloaddition
- Platinum-catalyzed intermolecular hydroamination
- Hydroformylation reactions
| | reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction
reaction type: Heck Reaction
reaction type: Hiyama Coupling
reaction type: Negishi Coupling
reaction type: Sonogashira Coupling
reaction type: Stille Coupling
reaction type: Suzuki-Miyaura Coupling
reagent type: ligand |
| | ETHYLDIPHENYLPHOSPHINE Preparation Products And Raw materials |
|