|
|
| | 4-Nitrobenzyl chloroformate Basic information |
| | 4-Nitrobenzyl chloroformate Chemical Properties |
| Melting point | 32-34 °C(lit.) | | Boiling point | 230°C 10mm | | density | 1.4928 (rough estimate) | | refractive index | 1.552-1.556 | | Fp | >230 °F | | storage temp. | 2-8°C | | solubility | Acetonitrile (Slightly), Chloroform (Slightly) | | form | powder to crystal | | color | White to Light yellow | | Sensitive | Moisture Sensitive | | BRN | 912446 | | Stability: | Stable, but moisture-sensitive. May develop pressure in storage. Incompatible with moisture, strong bases, alcohols, amines, acids. | | Major Application | peptide synthesis | | InChI | 1S/C8H6ClNO4/c9-8(11)14-5-6-1-3-7(4-2-6)10(12)13/h1-4H,5H2 | | InChIKey | MHSGOABISYIYKP-UHFFFAOYSA-N | | SMILES | [O-][N+](=O)c1ccc(COC(Cl)=O)cc1 | | CAS DataBase Reference | 4457-32-3(CAS DataBase Reference) | | NIST Chemistry Reference | Carbonochloridic acid, (4-nitrophenyl)methyl ester(4457-32-3) | | EPA Substance Registry System | Carbonochloridic acid, (4-nitrophenyl)methyl ester (4457-32-3) |
| Hazard Codes | C,T | | Risk Statements | 34-37-23/24/25-36/37 | | Safety Statements | 26-36/37/39-45-38-28A-27 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | F | 3-4.9 | | Hazard Note | Corrosive/Toxic/Moisture Sensitive | | TSCA | TSCA listed | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29159000 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1
Skin Corr. 1B
STOT SE 3 |
| | 4-Nitrobenzyl chloroformate Usage And Synthesis |
| Chemical Properties | off-white to pale yellow powder | | Uses | 4-Nitrobenzyl Chloroformate is used in the preparation of prodrugs of cytotoxic acridines used in conjunction with enzyme prodrugs which counter carcinoma cells. | | reaction suitability | reaction type: Carbonylations |
| | 4-Nitrobenzyl chloroformate Preparation Products And Raw materials |
|