| Company Name: |
QINGDAO KAIENSI INTERNATIONAL TRADE CO.,LTD. |
| Tel: |
+86-0532-8699-9256 +8615254267723 |
| Email: |
kaley@cnfdevelop.com |
| Products Intro: |
Product Name:4'-Bromo-1,1'-biphenyl-2,3,4,5,6-d5 CAS:51624-40-9 Purity:0.99 Package:0.1KG,1kg,5kg,10kg,100kg,200kg,1mt
|
|
|
|
|
| Company Name: |
China Langchem Inc.
|
| Tel: |
021-58956006,021-58950017 15800617331 |
| Email: |
sales@langchem.com |
| Products Intro: |
Product Name:4'-Bromo-1,1'-biphenyl-2,3,4,5,6-d5 CAS:51624-40-9 Package:1kg
|
| Company Name: |
Hangzhou J&H Chemical Co., Ltd.
|
| Tel: |
0571-87396432 |
| Email: |
sales@jhechem.com |
| Products Intro: |
Product Name:4'-Bromo-1,1'-biphenyl-2,3,4,5,6-d5 CAS:51624-40-9 Purity:98% HPLC Package:50KG;10KG;5KG;1KG
|
| Company Name: |
Nanjing Haolv Biotechnology Co.,Ltd
|
| Tel: |
025-84622273 17361806303 |
| Email: |
kexin.zhou@haolvbiotech.com |
| Products Intro: |
Product Name:4'-Bromo-1,1'-biphenyl-2,3,4,5,6-d5 CAS:51624-40-9 Purity:98%D Package:5g;10g;25g
|
|
| | 4'-Bromo-1,1'-biphenyl-2,3,4,5,6-d5 Basic information |
| Product Name: | 4'-Bromo-1,1'-biphenyl-2,3,4,5,6-d5 | | Synonyms: | 4'-Bromo-1,1'-biphenyl-2,3,4,5,6-d5;4-Bromo-1,1'-biphenyl-d5;4-Bromo-1,1'-biphenyl-d5 | | CAS: | 51624-40-9 | | MF: | C12H4BrD5 | | MW: | 238.13466889 | | EINECS: | | | Product Categories: | | | Mol File: | 51624-40-9.mol |  |
| | 4'-Bromo-1,1'-biphenyl-2,3,4,5,6-d5 Chemical Properties |
| Melting point | 89 °C(Solv: methanol (67-56-1)) | | InChI | InChI=1S/C12H9Br/c13-12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-9H/i1D,2D,3D,4D,5D | | InChIKey | PKJBWOWQJHHAHG-RALIUCGRSA-N | | SMILES | C1(C2=CC=C(Br)C=C2)=C([2H])C([2H])=C([2H])C([2H])=C1[2H] |
| | 4'-Bromo-1,1'-biphenyl-2,3,4,5,6-d5 Usage And Synthesis |
| Description | 4'-Bromo-1,1'-biphenyl-2,3,4,5,6-d5 is a deuterated biphenyl derivative, which offers distinct advantages in analytical and biochemical research due to its isotopic signature. |
| | 4'-Bromo-1,1'-biphenyl-2,3,4,5,6-d5 Preparation Products And Raw materials |
|