|
| 3-BROMO-2-CHLORO-6-PICOLINE Basic information |
| 3-BROMO-2-CHLORO-6-PICOLINE Chemical Properties |
Melting point | 30-35°C | Boiling point | 234.2±35.0 °C(Predicted) | density | 1.6567 (rough estimate) | refractive index | 1.5400 (estimate) | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | pka | 0.33±0.10(Predicted) | form | Solid | color | Yellow | InChI | InChI=1S/C6H5BrClN/c1-4-2-3-5(7)6(8)9-4/h2-3H,1H3 | InChIKey | JVDQYSIJBRTRMS-UHFFFAOYSA-N | SMILES | C1(Cl)=NC(C)=CC=C1Br | CAS DataBase Reference | 185017-72-5(CAS DataBase Reference) |
Provider | Language |
ACROS
| English |
| 3-BROMO-2-CHLORO-6-PICOLINE Usage And Synthesis |
Chemical Properties | Yellow low melting solid or liquid |
| 3-BROMO-2-CHLORO-6-PICOLINE Preparation Products And Raw materials |
|