|
|
| | 2-METHYL-4-NITROANISOLE 97 Basic information |
| | 2-METHYL-4-NITROANISOLE 97 Chemical Properties |
| Melting point | 61-64 °C(lit.) | | Boiling point | 283.0±20.0 °C(Predicted) | | density | 1.180±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | Solid | | color | Off-White | | InChI | 1S/C8H9NO3/c1-6-5-7(9(10)11)3-4-8(6)12-2/h3-5H,1-2H3 | | InChIKey | QOZMIJZYJZQOBV-UHFFFAOYSA-N | | SMILES | COc1ccc(cc1C)[N+]([O-])=O |
| Hazard Codes | Xn,Xi | | Risk Statements | 22-36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 2909309090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 2-METHYL-4-NITROANISOLE 97 Usage And Synthesis |
| Chemical Properties | Off-White Solid | | Uses | 2-Methyl-4-nitroanisole may be used in the synthesis of 2-methyl-4-nitrophenol and 3-methyl-4-methoxyaniline. | | General Description | 2-Methyl-4-nitroanisole is obtained as one of the products from the charge-transfer trinitromethylation of 2-methylanisole in the presence of dichloromethane. |
| | 2-METHYL-4-NITROANISOLE 97 Preparation Products And Raw materials |
|