| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | ((S)-(-)-1-(4-Nitrophenyl)-2-pyrrolidin& Basic information |
| Product Name: | ((S)-(-)-1-(4-Nitrophenyl)-2-pyrrolidin& | | Synonyms: | npp acrylate;[(2S)-1-(4-nitrophenyl)pyrrolidin-2-yl]methyl prop-2-enoate;2-Propenoic acid, [(2S)-1-(4-nitrophenyl)-2-pyrrolidinyl]methyl ester;(S)-(-)-1-(4-Nitrophenyl)-2-pyrrolidinemethyl]acrylate 97%;[(S)-(?)-1-(4-Nitrophenyl)-2-pyrrolidinemethyl]acrylate;((S)-(-)-1-(4-Nitrophenyl)-2-pyrrolidin& | | CAS: | 152100-45-3 | | MF: | C14H16N2O4 | | MW: | 276.29 | | EINECS: | | | Product Categories: | | | Mol File: | 152100-45-3.mol |  |
| | ((S)-(-)-1-(4-Nitrophenyl)-2-pyrrolidin& Chemical Properties |
| Melting point | 38-48 °C(lit.) | | Fp | >230 °F | | storage temp. | 2-8°C | | Optical Rotation | [α]20/D 46.0°, c = 1% in methanol | | InChI | 1S/C14H16N2O4/c1-2-14(17)20-10-13-4-3-9-15(13)11-5-7-12(8-6-11)16(18)19/h2,5-8,13H,1,3-4,9-10H2/t13-/m0/s1 | | InChIKey | HCVPUFHAWIINEQ-ZDUSSCGKSA-N | | SMILES | [O-][N+](=O)c1ccc(cc1)N2CCC[C@H]2COC(=O)C=C |
| Hazard Codes | Xi,N | | Risk Statements | 36/37/38-51/53 | | Safety Statements | 26-28-61 | | RIDADR | UN 3077 9/PG 3 | | WGK Germany | 2 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Chronic 2
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | ((S)-(-)-1-(4-Nitrophenyl)-2-pyrrolidin& Usage And Synthesis |
| General Description | NLO monomer |
| | ((S)-(-)-1-(4-Nitrophenyl)-2-pyrrolidin& Preparation Products And Raw materials |
|