1456803-42-1 manufacturers
|
| | 1456803-42-1 Basic information |
| Product Name: | 1456803-42-1 | | Synonyms: | Carbamic acid, N-[(5S,6R)-6-methyl-2-oxo-5-(2,3,6-trifluorophenyl)-3-piperidinyl]-, 1,1-dimethylethyl ester;tert-butyl ((5S,6R)-6-methyl-2-oxo-5-(2,3,6-trifluorophenyl)piperidin-3-yl)carbamate;N-(3S,6R)-6-Methyl-2-oxo-5-(2,3,6-trifluorophenyl)-3-piperidinylcarbamate tert-butyl ester - (SZ-2190) | | CAS: | 1456803-42-1 | | MF: | C17H21F3N2O3 | | MW: | 358.36 | | EINECS: | | | Product Categories: | | | Mol File: | 1456803-42-1.mol |  |
| | 1456803-42-1 Chemical Properties |
| Boiling point | 461.7±45.0 °C(Predicted) | | density | 1.26±0.1 g/cm3(Predicted) | | pka | 10.68±0.60(Predicted) | | InChI | InChI=1S/C17H21F3N2O3/c1-8-9(13-10(18)5-6-11(19)14(13)20)7-12(15(23)21-8)22-16(24)25-17(2,3)4/h5-6,8-9,12H,7H2,1-4H3,(H,21,23)(H,22,24)/t8-,9-,12/m1/s1 | | InChIKey | CARIKAXEUGTSFR-LSLJNABFSA-N | | SMILES | C(OC(C)(C)C)(=O)NC1C[C@@H](C2=C(F)C=CC(F)=C2F)[C@@H](C)NC1=O |
| | 1456803-42-1 Usage And Synthesis |
| | 1456803-42-1 Preparation Products And Raw materials |
|