| Company Name: |
Hubei Moco Chemical Co., Ltd.
|
| Tel: |
18627756402 |
| Email: |
3001051413@qq.com |
| Products Intro: |
Product Name:4-(2-((2-methylpentyl)amino)ethyl)indolin-2-one hydrochloride
CAS:221264-33-1
Purity:95% Package:25mg;50mg;100mg
|
| Company Name: |
Jinan blalong chemical co. LTD
|
| Tel: |
2710913286@.com |
| Email: |
1513643261@qq.com |
| Products Intro: |
Product Name:RopiniroleEPImpurityBHCl
CAS:221264-33-1
Purity:99% HPLC Package:50G;10G;1G;500MG;100MG
|
| Company Name: |
Molcoo Chemicals Inc.
|
| Tel: |
18274848843 |
| Email: |
3001006472@qq.com |
| Products Intro: |
Product Name:Ropinirole EP Impurity B
CAS:221264-33-1
Purity:95% Package:25mg;50mg;100mg
|
| Company Name: |
Hunan Zengda Biological Technology Co., LTD
|
| Tel: |
18711085600 |
| Email: |
1652923704@qq.com |
| Products Intro: |
Product Name:Ropinirole EP Impurity B HCl
CAS:221264-33-1
Purity:98% HPLC Package:10mg;25mg;50mg;100mg
|
Ropinirole EP Impurity B HCl manufacturers
|
| | Ropinirole EP Impurity B HCl Basic information |
| | Ropinirole EP Impurity B HCl Chemical Properties |
| InChI | InChI=1S/C16H24N2O.ClH/c1-3-5-12(2)11-17-9-8-13-6-4-7-15-14(13)10-16(19)18-15;/h4,6-7,12,17H,3,5,8-11H2,1-2H3,(H,18,19);1H | | InChIKey | JOGZDWYHUIGZLI-UHFFFAOYSA-N | | SMILES | C(C1=CC=CC2NC(=O)CC1=2)CNCC(C)CCC.Cl |
| | Ropinirole EP Impurity B HCl Usage And Synthesis |
| | Ropinirole EP Impurity B HCl Preparation Products And Raw materials |
|