2,2'-diamino-[1,1'-Biphenyl]-4,4'-dicarboxylic acid manufacturers
|
| | 2,2'-diamino-[1,1'-Biphenyl]-4,4'-dicarboxylic acid Basic information |
| Product Name: | 2,2'-diamino-[1,1'-Biphenyl]-4,4'-dicarboxylic acid | | Synonyms: | [1,1'-Biphenyl]-4,4'-dicarboxylic acid, 2,2'-diamino-;2,2'-diamino-[1,1'-Biphenyl]-4,4'-dicarboxylic acid;H2BPDC-(NH2)2;2,2’-Diaminobiphenyl-4,4’-dicarboxylic Acid | | CAS: | 41738-56-1 | | MF: | C14H12N2O4 | | MW: | 272.26 | | EINECS: | | | Product Categories: | | | Mol File: | 41738-56-1.mol | ![2,2'-diamino-[1,1'-Biphenyl]-4,4'-dicarboxylic acid Structure](CAS/20200401/GIF/41738-56-1.gif) |
| | 2,2'-diamino-[1,1'-Biphenyl]-4,4'-dicarboxylic acid Chemical Properties |
| Melting point | 307-309 °C | | Boiling point | 569.8±50.0 °C(Predicted) | | density | 1.476±0.06 g/cm3(Predicted) | | storage temp. | RT, protect from light | | pka | 3.95±0.10(Predicted) | | Appearance | White to yellow Solid | | InChI | InChI=1S/C14H12N2O4/c15-11-5-7(13(17)18)1-3-9(11)10-4-2-8(14(19)20)6-12(10)16/h1-6H,15-16H2,(H,17,18)(H,19,20) | | InChIKey | AEZBIGVULSBTBA-UHFFFAOYSA-N | | SMILES | C1(C2=CC=C(C(O)=O)C=C2N)=CC=C(C(O)=O)C=C1N |
| | 2,2'-diamino-[1,1'-Biphenyl]-4,4'-dicarboxylic acid Usage And Synthesis |
| Uses | 2,2'-diamino-[1,1'-Biphenyl]-4,4'-dicarboxylic acid can be used as organic synthesis intermediates and pharmaceutical intermediates, mainly used in laboratory research and development processes and chemical production processes. | | Synthesis |  2,2'-Diamino-[1,1;-biphenyl]-4,4;-dicarboxylic acid H2bpdc-(NH2)2. Dimethyl 2,2'-diamino-[1,1'-biphenyl]-4,4'-dicarboxylate(900 mg, 3.0 mmol) was dissolved in THF (20 mL) and 20 mL ofaqueous NaOH (0.6 M) were added dropwise under vigorous stirring.The mixture was stirred overnight at room temperature.The organic solvent was removed under vacuum and the aqueoussolution was acidified with acetic acid to yield a light brown solid(735 mg, 2.7 mmol, 90%). |
| | 2,2'-diamino-[1,1'-Biphenyl]-4,4'-dicarboxylic acid Preparation Products And Raw materials |
|