|
|
| | Pentanoic acid, 2-amino-5,5-difluoro-4,4-dimethyl-, (2S)- Basic information |
| Product Name: | Pentanoic acid, 2-amino-5,5-difluoro-4,4-dimethyl-, (2S)- | | Synonyms: | Pentanoic acid, 2-amino-5,5-difluoro-4,4-dimethyl-, (2S)-;NV-5138;(2S)-2-amino-5,5-difluoro-4,4-dimethylpentanoic acid;inhibit,Inhibitor,NV-5138,mTOR,NV5138,Mammalian target of Rapamycin,NV 5138 | | CAS: | 2095886-80-7 | | MF: | C7H13F2NO2 | | MW: | 181.18 | | EINECS: | | | Product Categories: | | | Mol File: | 2095886-80-7.mol |  |
| | Pentanoic acid, 2-amino-5,5-difluoro-4,4-dimethyl-, (2S)- Chemical Properties |
| storage temp. | Store at -20°C,unstable in solution, ready to use. | | solubility | DMSO: 10mM | | form | A solid | | InChI | InChI=1S/C7H13F2NO2/c1-7(2,6(8)9)3-4(10)5(11)12/h4,6H,3,10H2,1-2H3,(H,11,12)/t4-/m0/s1 | | InChIKey | HRFIMCJTDKEPPV-BYPYZUCNSA-N | | SMILES | C(O)(=O)[C@@H](N)CC(C)(C)C(F)F |
| | Pentanoic acid, 2-amino-5,5-difluoro-4,4-dimethyl-, (2S)- Usage And Synthesis |
| | Pentanoic acid, 2-amino-5,5-difluoro-4,4-dimethyl-, (2S)- Preparation Products And Raw materials |
|