| Company Name: |
Shanghai Subo Pharmaceutical Technology Co., Ltd. Gold
|
| Tel: |
021-54156369 16621315851 |
| Email: |
yhsuyiming@126.com |
| Products Intro: |
Product Name:(2S)-tert-Butyl 3-cyano-2-methyl-4-oxopiperidine-1-carboxylate
CAS:2212021-56-0
Purity:98% Package:1g;100g
|
|
| | (2S)-tert-Butyl 3-cyano-2-methyl-4-oxopiperidine-1-carboxylate Basic information |
| | (2S)-tert-Butyl 3-cyano-2-methyl-4-oxopiperidine-1-carboxylate Chemical Properties |
| Boiling point | 379.3±42.0 °C(Predicted) | | density | 1.13±0.1 g/cm3(Predicted) | | pka | -3.66±0.60(Predicted) | | InChI | InChI=1S/C12H18N2O3/c1-8-9(7-13)10(15)5-6-14(8)11(16)17-12(2,3)4/h8-9H,5-6H2,1-4H3/t8-,9?/m0/s1 | | InChIKey | HWSFSGRTZMJYGQ-IENPIDJESA-N | | SMILES | N1(C(OC(C)(C)C)=O)CCC(=O)C(C#N)[C@@H]1C |
| | (2S)-tert-Butyl 3-cyano-2-methyl-4-oxopiperidine-1-carboxylate Usage And Synthesis |
| | (2S)-tert-Butyl 3-cyano-2-methyl-4-oxopiperidine-1-carboxylate Preparation Products And Raw materials |
|