9,10-Dihydroanthracene manufacturers
|
| | 9,10-Dihydroanthracene Basic information |
| Product Name: | 9,10-Dihydroanthracene | | Synonyms: | 9,10-DIHYDROANTHRACENE, TECHN. 90%;9,10-Dihydroanthracene,99%;6-Methoxy-1-Tetralone99%;9,10-DIHYDROANTHRACENE OEKANAL;9,10-DIHYDROANTHRACENE, TECH., 85%;Anthracene, dihydro-;9.10-Dihydroanthracene 1g [613-31-0];9,10-Dihydroanthracene,90%,tech. | | CAS: | 613-31-0 | | MF: | C14H12 | | MW: | 180.25 | | EINECS: | 210-336-1 | | Product Categories: | Organic Building Blocks;Building Blocks;Arenes | | Mol File: | 613-31-0.mol |  |
| | 9,10-Dihydroanthracene Chemical Properties |
| Melting point | 103-107 °C (lit.) | | Boiling point | 312 °C (lit.) | | density | 0.88 g/mL at 25 °C (lit.) | | refractive index | 1.6415 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | color | White to Almost white | | Water Solubility | 1.332mg/L(24.59 ºC) | | BRN | 1364575 | | Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. | | InChI | InChI=1S/C14H12/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1/h1-8H,9-10H2 | | InChIKey | WPDAVTSOEQEGMS-UHFFFAOYSA-N | | SMILES | C1=C2C(CC3=C(C2)C=CC=C3)=CC=C1 | | CAS DataBase Reference | 613-31-0(CAS DataBase Reference) | | EPA Substance Registry System | Anthracene, 9,10-dihydro- (613-31-0) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 22-24/25-36/37-26 | | RIDADR | UN 3077 9 / PGIII | | WGK Germany | 3 | | HS Code | 2902.90.9000 | | HazardClass | 9 | | PackingGroup | III |
| | 9,10-Dihydroanthracene Usage And Synthesis |
| Chemical Properties | brown crystals | | Uses | 9,10-Dihydroanthracene(DHA) has been used in a study to assess the hydrogen abstraction capability of valence-delocalized iron complex with DHA in MeCN. | | General Description | 9,10-Dihydroanthracene causes the transfer hydrogenation of C60 and C70 in the presence of [7H]benzanthrene catalyst. It was oxidatively aromatized to the corresponding anthracene in the presence of molecular oxygen as an oxidant and activated carbon as a promoter in xylene. | | Purification Methods | Crystallise it from EtOH [Rabideau et al. J Am Chem Soc 108 8130 1986]. [Beilstein 5 H 641, 5 IV 2182.] |
| | 9,10-Dihydroanthracene Preparation Products And Raw materials |
|