- 1-Benzyl-3-Piperidinol
-
- $0.00 / 1kg
-
2023-11-02
- CAS:14813-01-5
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 100 tons
- 1-Benzyl-3-piperidinol
-
- $150.00 / 1KG
-
2023-09-25
- CAS:14813-01-5
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20 ton/month
|
| | 1-Benzyl-3-piperidinol Basic information |
| Product Name: | 1-Benzyl-3-piperidinol | | Synonyms: | 1-Benzyl-3-hydroxypiperidine,99%;CIS-1-BENZYL-2-METHYL-3-AMINO PYRROLIDINE;1-N-BENZYL-3-HYDROXY-PIPERIDINE;N-BENZYL-3-PIPERIDINOL;1-BENZYL-3-HYDROXYPIPERIDINE;1-BENZYL-PIPERIDIN-3-OL;1-BENZYL-3-PIPERIDINOL;3-PIPERIDINOL, 1-PHENYLMETHYL- | | CAS: | 14813-01-5 | | MF: | C12H17NO | | MW: | 191.27 | | EINECS: | 238-881-0 | | Product Categories: | Piperidine;john's | | Mol File: | 14813-01-5.mol |  |
| | 1-Benzyl-3-piperidinol Chemical Properties |
| Boiling point | 140-142°C 6mm | | density | 1,056 g/cm3 | | refractive index | n20/D 1.549 | | Fp | >230 °F | | storage temp. | Inert atmosphere,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | clear liquid | | pka | 14.82±0.20(Predicted) | | color | Colorless to Light yellow | | Sensitive | Hygroscopic | | BRN | 135964 | | InChI | InChI=1S/C12H17NO/c14-12-7-4-8-13(10-12)9-11-5-2-1-3-6-11/h1-3,5-6,12,14H,4,7-10H2 | | InChIKey | UTTCOAGPVHRUFO-UHFFFAOYSA-N | | SMILES | N1(CC2=CC=CC=C2)CCCC(O)C1 | | CAS DataBase Reference | 14813-01-5(CAS DataBase Reference) |
| Hazard Codes | T | | Risk Statements | 25-36/37/38 | | Safety Statements | 26-45 | | RIDADR | UN 2811 6.1/PG 3 | | WGK Germany | 2 | | HS Code | 29333990 |
| | 1-Benzyl-3-piperidinol Usage And Synthesis |
| Chemical Properties | Colorless liquid | | Uses | Reactant for bioresolution of tertiary amino ester protic ionic liquids using subtilisin
Reactant for synthesis of:
- Muscarinic M3 selective antagonists
- Rho kinase inhibitors
- Piperidine derivatives for investigations into α-adrenoreceptor direct activation
| | Waste Disposal | 2,4-Dichloro-5-methoxypyrimidine is a halogen-containing aromatic ring organic compound, which is more harmful to the water environment. Therefore, undiluted or large amounts of 2,4-dichloro-5-methoxypyrimidine should not be exposed to groundwater, waterways, or sewage systems. |
| | 1-Benzyl-3-piperidinol Preparation Products And Raw materials |
|