|
|
| | 3,5-Bis(trifluoromethyl)benzoyl chloride Basic information |
| Product Name: | 3,5-Bis(trifluoromethyl)benzoyl chloride | | Synonyms: | 3,5-Bis(trifluoromethyl)benzoylchloride98%;3,5-BIS(TRIFLUOROMETHYL)BENZOYCHLORIDE;Benzoyl chloride, 3,5-bis(trifluoromethyl)-;3,5-Bis(trifluoromethyl)benzoic acid chloride;3,5-Bis(trifluoromethyl)benzoyl chloride,97%;Benzoyl Chloride, 3;3,5-bis(Trifluoromethyl)benzoyl chloride, 95+%;[3,5-bis(trifluoroMethyl)phenyl]carbonylchloranuide | | CAS: | 785-56-8 | | MF: | C9H3ClF6O | | MW: | 276.56 | | EINECS: | 212-322-0 | | Product Categories: | Acid Halides;Carbonyl Compounds;Miscellaneous;Benzotrifluoride Series;Organic Building Blocks | | Mol File: | 785-56-8.mol |  |
| | 3,5-Bis(trifluoromethyl)benzoyl chloride Chemical Properties |
| Melting point | 5-10C | | Boiling point | 65-67 °C (12 mmHg) | | density | 1.526 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.435(lit.) | | Fp | 162 °F | | storage temp. | Store at room temperature, keep dry and cool | | form | Liquid | | Specific Gravity | 1.526 (20/4℃) | | color | Clear colorless to very slightly yellow | | Sensitive | Moisture Sensitive | | BRN | 2593440 | | InChI | 1S/C9H3ClF6O/c10-7(17)4-1-5(8(11,12)13)3-6(2-4)9(14,15)16/h1-3H | | InChIKey | WAKMMQSMEDJRRI-UHFFFAOYSA-N | | SMILES | FC(F)(F)c1cc(cc(c1)C(F)(F)F)C(Cl)=O | | CAS DataBase Reference | 785-56-8(CAS DataBase Reference) |
| Hazard Codes | C | | Risk Statements | 34-37-36 | | Safety Statements | 26-36/37/39-45-27 | | RIDADR | UN 3265 8/PG 2 | | WGK Germany | 3 | | F | 10-19-21 | | Hazard Note | Corrosive | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29163990 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | 3,5-Bis(trifluoromethyl)benzoyl chloride Usage And Synthesis |
| Chemical Properties | clear colorless to very slightly yellow liquid | | Uses | 3,5-Bis(trifluoromethyl)benzoyl chloride was used in the quantitative and selective assay for the measurement of low levels of clonidine in human plasma. |
| | 3,5-Bis(trifluoromethyl)benzoyl chloride Preparation Products And Raw materials |
|