1,1,2,2-TETRACHLOROETHANE-D2 manufacturers
|
| | 1,1,2,2-TETRACHLOROETHANE-D2 Basic information |
| Product Name: | 1,1,2,2-TETRACHLOROETHANE-D2 | | Synonyms: | 1,1,2,2-tetrachloro-[1,2-2H2]ethane;1,1,2,2-TETRACHLOROETHANE-D2, 99.5+ ATOM % D;1,1,2,2-TETRACHLOROETHANE-D2 DEUTERATION DEGREE MIN. 99 ATOM % D;1,1,2,2-TETRACHLOROETHANE-D2 DEUTE-RATIO N DEGREE MIN. 99,5 ATOM % D;1,1,2,2-TetrachloroethaneGr;1,1,2,2-Tetrachloroethane-d2, 99 atom % D, for NMR;ACETYLENE TETRACHLORIDE;TETRACHLOROETHANE D2 | | CAS: | 33685-54-0 | | MF: | C2Cl4D2 | | MW: | 169.86 | | EINECS: | 251-634-1 | | Product Categories: | | | Mol File: | 33685-54-0.mol |  |
| | 1,1,2,2-TETRACHLOROETHANE-D2 Chemical Properties |
| Melting point | -44°C | | Melting point | -44°C | | Boiling point | 146,5°C | | Boiling point | 145-146 °C737 mm Hg(lit.) | | density | 1.62 g/mL at 25 °C(lit.) | | density | d = 1,62 | | vapor pressure | 6.6 hPa (20 °C) | | refractive index | n20/D 1.493(lit.) | | Fp | 147°C | | storage temp. | Storage temperature: no restrictions. | | solubility | 3g/l | | form | Liquid | | Specific Gravity | 1.62 | | color | Colorless | | Water Solubility | Slightly soluble in water. Soluble in ether, chloroform, ethanol, tetrachloromethane, methanol, acetone, petroleum spirit, carbon disulfide, dimethyl formamide and benzene. | | BRN | 1699903 | | Stability: | Volatile | | InChI | 1S/C2H2Cl4/c3-1(4)2(5)6/h1-2H/i1D,2D | | InChIKey | QPFMBZIOSGYJDE-QDNHWIQGSA-N | | SMILES | ClC(Cl)(C(Cl)(Cl)[2H])[2H] | | CAS DataBase Reference | 33685-54-0(CAS DataBase Reference) | | EPA Substance Registry System | 1,1,2,2-Tetrachloroethane-d2 (33685-54-0) |
| Hazard Codes | T+,N | | Risk Statements | 26/27-51/53 | | Safety Statements | 38-45-61 | | RIDADR | UN 1702 6.1/PG 2 | | WGK Germany | 3 | | F | 8-10 | | HS Code | 2845 90 10 | | HazardClass | 6.1 | | PackingGroup | II | | Storage Class | 6.1B - Non-combustible, acute toxic Cat. 1 and 2 very toxic hazardous materials | | Hazard Classifications | Acute Tox. 1 Dermal Acute Tox. 2 Inhalation Aquatic Chronic 2 |
| | 1,1,2,2-TETRACHLOROETHANE-D2 Usage And Synthesis |
| Chemical Properties | clear colorless liquid | | Uses | Isotope labelled 1,1,2,2-Tetrachloroethane is a material used in the manufacturing of thermoelectric material including carbon nanotubes. It was primarily used as a solvent however due to toxicity it is no longer a viable compound. | | Definition | ChEBI: 1,1,2,2-tetrachlorethane-d2 is a deuterated compound and a member of chloroethanes. |
| | 1,1,2,2-TETRACHLOROETHANE-D2 Preparation Products And Raw materials |
|