|
|
| | (S)-1-Boc-2-benzylpiperazine Basic information |
| Product Name: | (S)-1-Boc-2-benzylpiperazine | | Synonyms: | (S)-1-Boc-2-Benzylpiperizine;(S)-1-BOC-2-BENZYL-PIPERAZINE 98%;(S)-2-Benzylpiperazine, N1-BOC protected;(S)-tert-Butyl 2-benzylpiperazine-1-carboxylate;1-Piperazinecarboxylic acid, 2-(phenylmethyl)-, 1,1-dimethylethyl ester, (2S)-;(S)-1-N-Boc-2-Benzylpiperazine ,98%;tert-butyl (2S)-2-benzylpiperazine-1-carboxylate;S-1-Boc-2-benzylylpiperazine | | CAS: | 169447-86-3 | | MF: | C16H24N2O2 | | MW: | 276.37 | | EINECS: | | | Product Categories: | Piperaizine | | Mol File: | 169447-86-3.mol |  |
| | (S)-1-Boc-2-benzylpiperazine Chemical Properties |
| Boiling point | 382.9±17.0 °C(Predicted) | | density | 1.066±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 8.45±0.40(Predicted) | | Appearance | Colorless to light yellow Solid | | InChI | InChI=1S/C16H24N2O2/c1-16(2,3)20-15(19)18-10-9-17-12-14(18)11-13-7-5-4-6-8-13/h4-8,14,17H,9-12H2,1-3H3/t14-/m0/s1 | | InChIKey | QKUHUJCLUFLGCI-AWEZNQCLSA-N | | SMILES | N1(C(OC(C)(C)C)=O)CCNC[C@@H]1CC1=CC=CC=C1 | | CAS DataBase Reference | 169447-86-3(CAS DataBase Reference) |
| | (S)-1-Boc-2-benzylpiperazine Usage And Synthesis |
| | (S)-1-Boc-2-benzylpiperazine Preparation Products And Raw materials |
|