| Company Name: |
Changzhou Ansciep Chemical Co., Ltd. |
| Tel: |
+86 519 86305871 |
| Email: |
sales@ansciepchem.com |
| Products Intro: |
Product Name:1,3,5-TRIMETHYL-1,3,5-TRIPHENYLCYCLOTRISILOXANE CAS:546-45-2 Purity:98% Package:100g, 500g, 1kg, 25kg, 50kg, 200kg Remarks:Good quality; Large stock; Hot sale
|
|
|
|
|
|
| | 1,3,5-TRIMETHYL-1,3,5-TRIPHENYLCYCLOTRISILOXANE Basic information |
| Product Name: | 1,3,5-TRIMETHYL-1,3,5-TRIPHENYLCYCLOTRISILOXANE | | Synonyms: | 2,4,6-Trimethyl-2,4,6-triphenyl-1,3,5,2,4,6-trioxatrisilinane;2,4,6-trimethyl-2,4,6-triphenyl-cyclotrisiloxan;Cyclotrisiloxane, 2,4,6-trimethyl-2,4,6-triphenyl-;PHENYLMETHYLCYCLOSILOXANES;TRIPHENYLTRIMETHYLCYCLOTRISILOXANE;2,4,6-TRIMETHYL-2,4,6-TRIPHENYLCYCLOTRISILOXANE;1,3,5-TRIMETHYL-1,3,5-TRIPHENYLCYCLOTRISILOXANE;1,3,5-TRIMETHYL-1,3,5-TRIPHENYLCYCLOTRISILOXANE, MIXED CIS,TRANS ISOMERS | | CAS: | 546-45-2 | | MF: | C21H24O3Si3 | | MW: | 408.67 | | EINECS: | 208-900-7 | | Product Categories: | Chemical Synthesis;Organometallic Reagents;Organosilicon;Siloxanes | | Mol File: | 546-45-2.mol |  |
| | 1,3,5-TRIMETHYL-1,3,5-TRIPHENYLCYCLOTRISILOXANE Chemical Properties |
| Melting point | 100°C | | Boiling point | 160-90°C 5mm | | density | 1.102 g/mL at 20 °C(lit.) | | refractive index | 1.545 | | Fp | >200°C | | storage temp. | Sealed in dry,Room Temperature | | form | solid | | Specific Gravity | 1.1 | | Hydrolytic Sensitivity | 1: no significant reaction with aqueous systems | | BRN | 2954104 | | InChI | InChI=1S/C21H24O3Si3/c1-25(19-13-7-4-8-14-19)22-26(2,20-15-9-5-10-16-20)24-27(3,23-25)21-17-11-6-12-18-21/h4-18H,1-3H3 | | InChIKey | HAURRGANAANPSQ-UHFFFAOYSA-N | | SMILES | [Si]1(C)(O[Si](O[Si](C)(C2C=CC=CC=2)O1)(C)C1C=CC=CC=1)C1=CC=CC=C1 | | EPA Substance Registry System | Cyclotrisiloxane, 2,4,6-trimethyl-2,4,6-triphenyl- (546-45-2) |
| | 1,3,5-TRIMETHYL-1,3,5-TRIPHENYLCYCLOTRISILOXANE Usage And Synthesis |
| Chemical Properties | Colorless to white solid | | Definition | ChEBI: Cis-2,4,6-Trimethyl-2,4,6-triphenylcyclotrisiloxane is an organosilicon compound. |
| | 1,3,5-TRIMETHYL-1,3,5-TRIPHENYLCYCLOTRISILOXANE Preparation Products And Raw materials |
|