2-(2,6-dioxopiperidin-3-yl)-5,6-difluoroisoindoline-1,3-dione manufacturers
|
| | 2-(2,6-dioxopiperidin-3-yl)-5,6-difluoroisoindoline-1,3-dione Basic information |
| Product Name: | 2-(2,6-dioxopiperidin-3-yl)-5,6-difluoroisoindoline-1,3-dione | | Synonyms: | 2-(2,6-dioxopiperidin-3-yl)-5,6-difluoroisoindoline-1,3-dione;1H-Isoindole-1,3(2H)-dione, 2-(2,6-dioxo-3-piperidinyl)-5,6-difluoro-;6-difluoroisoindoline-1;6-Dioxopiperidin-3-yl)-5;Thalidomide-5,6-F;2-(2,6-Dioxo-3-piperidyl)-5,6-difluoroisoindoline-1,3-dione;5,6-Difluoro-thalidomide,AUN97411;Poma-5,6-2F | | CAS: | 1496997-41-1 | | MF: | C13H8F2N2O4 | | MW: | 294.21 | | EINECS: | | | Product Categories: | | | Mol File: | 1496997-41-1.mol |  |
| | 2-(2,6-dioxopiperidin-3-yl)-5,6-difluoroisoindoline-1,3-dione Chemical Properties |
| Boiling point | 534.6±50.0 °C(Predicted) | | density | 1.633±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, sealed storage, away from moisture | | pka | 10.50±0.40(Predicted) | | form | Solid | | color | Off-white to gray | | InChI | InChI=1S/C13H8F2N2O4/c14-7-3-5-6(4-8(7)15)13(21)17(12(5)20)9-1-2-10(18)16-11(9)19/h3-4,9H,1-2H2,(H,16,18,19) | | InChIKey | AGHXYRKTAZEQQW-UHFFFAOYSA-N | | SMILES | C1(=O)C2=C(C=C(F)C(F)=C2)C(=O)N1C1CCC(=O)NC1=O |
| | 2-(2,6-dioxopiperidin-3-yl)-5,6-difluoroisoindoline-1,3-dione Usage And Synthesis |
| Description | Thalidomide-5,6-F is used in the recruitment of the cereblon protein and also used as a PROTAC linker. | | Uses | Thalidomide-5,6-F is the Thalidomide-based cereblon ligand used in the recruitment of CRBN protein. Thalidomide-5,6-F can be connected to the ligand for protein by a linker to form PROTACs[1]. | | IC 50 | Cereblon | | References | [1] Liu K, et al. Design and biological characterization of hybrid compounds of curcumin and thalidomide for multiple myeloma. Org Biomol Chem. 2013;11(29):4757-4763. DOI:10.1039/c3ob40595h |
| | 2-(2,6-dioxopiperidin-3-yl)-5,6-difluoroisoindoline-1,3-dione Preparation Products And Raw materials |
|