|
|
| | 4-Benzo[b]thien-2-ylbenzenamine Basic information |
| | 4-Benzo[b]thien-2-ylbenzenamine Chemical Properties |
| Melting point | 144-145 °C | | Boiling point | 413.7±20.0 °C(Predicted) | | density | 1.247±0.06 g/cm3(Predicted) | | pka | 4.04±0.10(Predicted) | | InChI | InChI=1S/C14H11NS/c15-12-7-5-10(6-8-12)14-9-11-3-1-2-4-13(11)16-14/h1-9H,15H2 | | InChIKey | KCZKJUGTTGALLE-UHFFFAOYSA-N | | SMILES | C1(N)=CC=C(C2SC3=CC=CC=C3C=2)C=C1 |
| | 4-Benzo[b]thien-2-ylbenzenamine Usage And Synthesis |
| Uses | Used as a pharmaceutical intermediate for laboratory research. | | Synthesis | 4-Benzo[b]thiophen-2-yl-phenylamine was prepared according to the following procedure. A mixture of 4-iodoaniline (2.5 g, 11.2 mmol), 2-benzothio-pheneboronic acid (2.0 g, 11.2 mmol) and sodium carbonate (1.2 g, 11.2 mmol) in toluene (60 mL), ethanol (10 mL) and water (1 mL) was degassed with nitrogen for 5 min. A catalytic amount of Pd(dppf)2Cl2 was added, and the mixture was heated to reflux for 3 h. The mixture was cooled, adsorbed onto silica gel and purified by flash chromatography, 4-benzo[b]thiophen-2-yl-phenylamine.
![4-Benzo[b]thien-2-ylbenzenamine synthesis](/NewsImg/2023-05-30/6382106378916897303984555.png "4-Benzo[b]thien-2-ylbenzenamine synthesis") |
| | 4-Benzo[b]thien-2-ylbenzenamine Preparation Products And Raw materials |
|