|
|
| | (S)-(-)-1-tert-Butoxycarbonyl-3-aminopyrrolidine Basic information |
| | (S)-(-)-1-tert-Butoxycarbonyl-3-aminopyrrolidine Chemical Properties |
| alpha | -2 º (c=1, chloroform) | | Boiling point | 216-217 °C(lit.) | | density | 1.067 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.4720(lit.) | | Fp | 196 °F | | storage temp. | Keep in dark place,Inert atmosphere,2-8°C | | form | Liquid | | pka | 9.55±0.20(Predicted) | | color | Clear colorless to yellow | | Optical Rotation | [α]20/D 2°, c = 1 in chloroform | | Sensitive | Air Sensitive | | BRN | 8312125 | | InChI | InChI=1S/C9H18N2O2/c1-9(2,3)13-8(12)11-5-4-7(10)6-11/h7H,4-6,10H2,1-3H3/t7-/m0/s1 | | InChIKey | CMIBWIAICVBURI-ZETCQYMHSA-N | | SMILES | N1(C(OC(C)(C)C)=O)CC[C@H](N)C1 | | CAS DataBase Reference | 147081-44-5(CAS DataBase Reference) |
| Hazard Codes | Xn,C,Xi | | Risk Statements | 22-41 | | Safety Statements | 26 | | RIDADR | UN 2810 6.1/PG 3 | | WGK Germany | 2 | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29339900 |
| | (S)-(-)-1-tert-Butoxycarbonyl-3-aminopyrrolidine Usage And Synthesis |
| Chemical Properties | Colorless to light yellow liqui | | Uses | (S)-(-)-1-Boc-3-aminopyrrolidine may be used to prepare:
- Descarboxamide analog of 4-N-(Nω-nitro-L-argininyl)-trans-4-amino-L-proline amide.
- Histamine 3 (H3) receptor antagonists containing pyrrolidin-3-yl-N-methylbenzamide moiety.
| | Synthesis | To a solution of compound 178 (2.0 g, 9.42 mmol, 1.0 eq.) in methanol (40 mL) was added palladium carbon (1.0 g, 0.94 mmol, 0.1 eq.). The reaction mixture was subjected to hydrogenation at atmospheric pressure and room temperature for 6 hours. After completion of the reaction, the reaction mixture was filtered through diatomaceous earth and the filtrate was concentrated under reduced pressure. The target compound (S)-1-Boc-3-aminopyrrolidine was obtained as a yellow oil (1.7 g, 97% yield). | | References | [1] Patent: US2009/221565, 2009, A1. Location in patent: Page/Page column 51 [2] Patent: WO2016/34134, 2016, A1. Location in patent: Paragraph 00470 [3] Patent: CN105399698, 2016, A. Location in patent: Paragraph 1340-1342 [4] Patent: WO2005/811, 2005, A1. Location in patent: Page/Page column 61 [5] Patent: WO2005/20975, 2005, A2. Location in patent: Page/Page column 221 |
| | (S)-(-)-1-tert-Butoxycarbonyl-3-aminopyrrolidine Preparation Products And Raw materials |
|