| | 2,5-Dichloronitrobenzene Basic information |
| Product Name: | 2,5-Dichloronitrobenzene | | Synonyms: | Benzene, 2,5-dichloronitro-;Benzene,1,4-dichloro-2-nitro-;Benzene,1-nitro-2,5-dichloro;NITRO-P-DICHLOROBENZENE;2-NITRO-1,4-DICHLOROBENZENE;2-NITRO-P-DICHLOROBENZENE;2,5-DICHLORO-1-NITROBENZENE;2,5-DICHLORONITROBENZENE | | CAS: | 89-61-2 | | MF: | C6H3Cl2NO2 | | MW: | 192 | | EINECS: | 201-923-3 | | Product Categories: | Aromatic Halides (substituted);Benzene derivates;Dyestuff Intermediates;Intermediates of Dyes and Pigments | | Mol File: | 89-61-2.mol |  |
| | 2,5-Dichloronitrobenzene Chemical Properties |
| Melting point | 52-54 °C(lit.) | | Boiling point | 267 °C | | density | 1,442 g/cm3 | | vapor density | 6.6 (vs air) | | vapor pressure | <0.1 mm Hg ( 25 °C) | | refractive index | 1.4390 (estimate) | | Fp | >230 °F | | storage temp. | Store below +30°C. | | solubility | 0.083g/l | | form | solid | | color | Pale Yellow | | explosive limit | 2.4-8.5%(V) | | Water Solubility | Soluble in water, ethanol, ether, benzene, carbon disulfide. Slightly soluble in carbon tetrachloride. | | BRN | 778109 | | InChI | 1S/C6H3Cl2NO2/c7-4-1-2-5(8)6(3-4)9(10)11/h1-3H | | InChIKey | RZKKOBGFCAHLCZ-UHFFFAOYSA-N | | SMILES | [O-][N+](=O)c1cc(Cl)ccc1Cl | | LogP | 2.87 at 25℃ | | CAS DataBase Reference | 89-61-2(CAS DataBase Reference) | | IARC | 2B (Vol. 65, 123) 2020 | | NIST Chemistry Reference | Benzene, 1,4-dichloro-2-nitro-(89-61-2) | | EPA Substance Registry System | 2,5-Dichloronitrobenzene (89-61-2) |
| Hazard Codes | Xn,N | | Risk Statements | 22-36-51/53 | | Safety Statements | 26-60 | | RIDADR | UN 3077 9/PG 3 | | WGK Germany | 2 | | RTECS | CZ5260000 | | TSCA | TSCA listed | | HazardClass | 9 | | PackingGroup | III | | HS Code | 29049085 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 2 | | Hazardous Substances Data | 89-61-2(Hazardous Substances Data) |
| | 2,5-Dichloronitrobenzene Usage And Synthesis |
| Chemical Properties | yellow flakes | | Uses | 2,5-Dichloronitrobenzene is a reagent used in the synthesis of antitrypanosomal, antileishmanial and antimalarial agents. Also it is used in the synthesis of lysophosphatidic acid acyltransferase-β inhibitors. | | Production Methods | Nitration of 1,4-dichlorobenzene with mixed acid at 35 – 65 ℃ results in a 98 % yield of essentially pure 2,5-Dichloronitrobenzene. | | Purification Methods | Crystallise the nitrobenzene from absolute EtOH. [Beilstein 5 IV 726.] |
| | 2,5-Dichloronitrobenzene Preparation Products And Raw materials |
|