|
|
| | 4-Methoxy-N,6-dimethyl-1,3,5-triazin-2-amine Basic information |
| Product Name: | 4-Methoxy-N,6-dimethyl-1,3,5-triazin-2-amine | | Synonyms: | 2-METHYLAMINO-4-METHYL-6-METHOXY-1,3,5-TRIAZINE;2-METHOXY-4-METHYL-6-(METHYLAMINO)-1,3,5-TRIAZINE;2-methoxy-4-methyl-6-methylamino-s-triazine;2-AMINO-4-METHYL-6-METHOXY(N-METHYL)-1,3,5-TRIAZINE;4-methoxy-n,6-dimethyl-1,3,5-triazin-2-amine;4-METHOXY-N,6-DIMETHYL-1,3,5-TRIAZIN-2-YLAMINE;N,6-DIMETHYL-4-METHOXY-1,3,5-TRIAZIN-2-YLAMINE;5-triazin-2-amine,4-methoxy-n,6-dimethyl-3 | | CAS: | 5248-39-5 | | MF: | C6H10N4O | | MW: | 154.17 | | EINECS: | 401-360-5 | | Product Categories: | Building Blocks;Heterocyclic Building Blocks;Triazines | | Mol File: | 5248-39-5.mol |  |
| | 4-Methoxy-N,6-dimethyl-1,3,5-triazin-2-amine Chemical Properties |
| Melting point | 162-166 °C(lit.) | | Boiling point | 304.9±25.0 °C(Predicted) | | density | 1.196±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | DMSO (Slightly, Heated), Methanol (Slightly, Heated) | | form | Solid | | pka | 3.80±0.10(Predicted) | | color | Pale Beige | | InChI | InChI=1S/C6H10N4O/c1-4-8-5(7-2)10-6(9-4)11-3/h1-3H3,(H,7,8,9,10) | | InChIKey | MNDSUSQBIDHEJU-UHFFFAOYSA-N | | SMILES | N1=C(C)N=C(OC)N=C1NC | | CAS DataBase Reference | 5248-39-5(CAS DataBase Reference) | | EPA Substance Registry System | 1,3,5-Triazin-2-amine, 4-methoxy-N,6-dimethyl- (5248-39-5) |
| | 4-Methoxy-N,6-dimethyl-1,3,5-triazin-2-amine Usage And Synthesis |
| Uses | 4-Methoxy-n,6-dimethyl-1,3,5-triazin-2-amine is a metabolite of tribenuron-methyl used in herbicidal formulations or used as herbicides. |
| | 4-Methoxy-N,6-dimethyl-1,3,5-triazin-2-amine Preparation Products And Raw materials |
|