- Quinfamide
-
- $46.00 / 1mg
-
2026-04-21
- CAS:62265-68-3
- Min. Order:
- Purity: 99.92%
- Supply Ability: 10g
|
| | Quinfamide Basic information |
| Product Name: | Quinfamide | | Synonyms: | quinfamide;QUINTAMIDE;2-Furancarboxylic acid 1-(dichloroacetyl)-1,2,3,4-tetrahydroquinolin-6-yl ester;Win-40014;1-(Dichloroacetyl)-6-(2-furoyloxy)-1,2,3,4-tetrahydro-6-quinoline;2-Furancarboxylic Acid 1-(2,2-Dichloroacetyl)-1,2,3,4-tetrahydro-6-quinolinyl Ester;AMenide;AMenox | | CAS: | 62265-68-3 | | MF: | C16H13Cl2NO4 | | MW: | 354.18 | | EINECS: | 2634781 | | Product Categories: | Intermediates & Fine Chemicals;Pharmaceuticals | | Mol File: | 62265-68-3.mol |  |
| | Quinfamide Chemical Properties |
| Melting point | 145-146°C | | Boiling point | 551.3±50.0 °C(Predicted) | | density | 1.428±0.06 g/cm3(Predicted) | | storage temp. | Hygroscopic, -20°C Freezer, Under Inert Atmosphere | | solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly, Heated) | | form | Solid | | pka | -0.01±0.20(Predicted) | | color | White to Pale Beige | | Stability: | Hygroscopic | | InChI | InChI=1S/C16H13Cl2NO4/c17-14(18)15(20)19-7-1-3-10-9-11(5-6-12(10)19)23-16(21)13-4-2-8-22-13/h2,4-6,8-9,14H,1,3,7H2 | | InChIKey | SBJGFIXQRZOVTO-UHFFFAOYSA-N | | SMILES | O1C=CC=C1C(OC1C=CC2=C(C=1)CCCN2C(C(Cl)Cl)=O)=O |
| | Quinfamide Usage And Synthesis |
| Description | Quinfamide is an amebicide indicated for the one-day treatment of subacute or
chronic intestinal amebiasis. It acts by rendering the trophozoites of E. histolytica
incapable of propagation. | | Chemical Properties | Off-White Solid | | Originator | Sterling-Winthrop (USA) | | Uses | Quinfamide is an anti-amebic agent used to treat tropical parasitic infections. | | Uses | An antiamebic agent, used to treat tropical parasitic infections | | Definition | ChEBI: Quinfamide is a member of quinolines. | | Brand name | Amenide (Sterling Winthrop);AMENOX. |
| | Quinfamide Preparation Products And Raw materials |
|