- 5,6-Difluoroindanone
-
- $1.00 / 1KG
-
2020-01-03
- CAS:161712-77-2
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 1kg-1000kg
|
| | 5,6-Difluoroindanone Basic information |
| Product Name: | 5,6-Difluoroindanone | | Synonyms: | 1H-Inden-1-one, 5,6-difluoro-2,3-dihydro-;5,6-Difluoro-1-indanone;5,6-Difluoroindanone;5,6-difluoro-2,3-dihydroinden-1-one;3-dihydroinden-1-one;6-difluoro-2;6-Difluoroindanone | | CAS: | 161712-77-2 | | MF: | C9H6F2O | | MW: | 168.14 | | EINECS: | | | Product Categories: | Indanone & Indene | | Mol File: | 161712-77-2.mol |  |
| | 5,6-Difluoroindanone Chemical Properties |
| Boiling point | 251.3±40.0 °C(Predicted) | | density | 1.362±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | solid | | color | White to light yellow | | InChI | InChI=1S/C9H6F2O/c10-7-3-5-1-2-9(12)6(5)4-8(7)11/h3-4H,1-2H2 | | InChIKey | OSJRTWXVMCRBKZ-UHFFFAOYSA-N | | SMILES | C1(=O)C2=C(C=C(F)C(F)=C2)CC1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | TSCA | No | | HS Code | 2914790090 |
| | 5,6-Difluoroindanone Usage And Synthesis |
| | 5,6-Difluoroindanone Preparation Products And Raw materials |
|