|
|
| | CHLORO(TRI-TERT-BUTYLPHOSPHINE)GOLD(I) Basic information | | Reaction |
| Product Name: | CHLORO(TRI-TERT-BUTYLPHOSPHINE)GOLD(I) | | Synonyms: | (Tri-tert-butylphosphine)chlorogold;Chloro(tri-tert-butylphosphine)gold;Tri-tert-butylphosphinegold chloride;(tBu3P)AuCl;Chlorotri-t-butylphosphinegold(I),98%;CHLORO(TRI-TERT-BUTYLPHOSPHINE)GOLD(I);Chlorotri-t-butylphosphinegold(I),99%;(Tri-tert-butylphosphine)gold(I) chloride | | CAS: | 69550-28-3 | | MF: | C12H27P.AuCl | | MW: | 434.74 | | EINECS: | | | Product Categories: | Au;metal phosphine complex | | Mol File: | 69550-28-3.mol |  |
| | CHLORO(TRI-TERT-BUTYLPHOSPHINE)GOLD(I) Chemical Properties |
| Melting point | >300 °C | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | solid | | color | white microcrystal | | InChI | 1S/C12H27P.Au.ClH/c1-10(2,3)13(11(4,5)6)12(7,8)9;;/h1-9H3;;1H/q;+1;/p-1 | | InChIKey | JLXSZGSXDDQSJF-UHFFFAOYSA-M | | SMILES | Cl[Au].CC(C)(C)P(C(C)(C)C)C(C)(C)C |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 45 | | RIDADR | UN 2811 6.1/PG 3 | | WGK Germany | 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | CHLORO(TRI-TERT-BUTYLPHOSPHINE)GOLD(I) Usage And Synthesis |
| Reaction |
- Catalyst used for cycloisomerization reactions of 2-(2-propynyl)pyridine N-oxides.
- Catalyst used for the cycloisomerization of 1,6-diynes.
- Catalyst used for cycloisomerizations terminated by sp3 C-H bond insertion
- Synthesis of aromatic ketones by a transition metal-catalyzed tandem sequence.
| | Uses | Gold Catalysts — 21st Century ′Gold Rush′
- Useful catalyst in a variety of C-C bond forming reactions, including cyclopropanation.
| | reaction suitability | core: gold
reagent type: catalyst |
| | CHLORO(TRI-TERT-BUTYLPHOSPHINE)GOLD(I) Preparation Products And Raw materials |
|