- Tropine-3-thiol HCI
-
- $0.00 / 25kg
-
2023-11-01
- CAS:908266-48-8
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 2 t
|
| | Tropine-3-thiol hydrochloride Basic information |
| Product Name: | Tropine-3-thiol hydrochloride | | Synonyms: | Tropine-3-thiol hydrochloride;Tropine-3-thiol Hcl;8-Methyl-8-azabicyclo[3.2.1]octane-3-thiol hydrochloride;Tropine-3-thiol hydr;tropine-3-tiol hydrochloride;8-Azabicyclo[3.2.1]octane-3-thiol, 8-Methyl-, hydrochloride, (3-endo)-;8-Azabicyclo[3.2.1]octane-3-thiol,8-methyl-, hydrochloride (1:1), (3-endo)-;Retapamulin Impurity 8 | | CAS: | 908266-48-8 | | MF: | C8H16ClNOS | | MW: | 193.74 | | EINECS: | 1308068-626-2 | | Product Categories: | | | Mol File: | 908266-48-8.mol |  |
| | Tropine-3-thiol hydrochloride Chemical Properties |
| Melting point | 239-241°C | | storage temp. | Hygroscopic, Refrigerator, under inert atmosphere | | solubility | Methanol (Slightly), Water (Slightly) | | form | Solid | | color | Off-White | | Stability: | Hygroscopic | | InChI | InChI=1/C8H15NS.ClH/c1-9-6-2-3-7(9)5-8(10)4-6;/h6-8,10H,2-5H2,1H3;1H/t6-,7+,8+; | | InChIKey | IOTZTIZFEAOBRO-OQBUZWGDNA-N | | SMILES | [C@]12(CC[C@@]([H])(C[C@@H](S)C1)N2C)[H].Cl |&1:0,3,6,r| |
| | Tropine-3-thiol hydrochloride Usage And Synthesis |
| Uses | Tropine-3-thiol Hydrochloride is a derivative of Tropine (T892665), an oxidative product of Tropane, used to synthesize alkaloid derivatives. |
| | Tropine-3-thiol hydrochloride Preparation Products And Raw materials |
|