- 4-Fluoro-N-isopropylaniline
-
- $200.00 / 1KG
-
2024-01-02
- CAS:70441-63-3
- Min. Order: 1KG
- Purity: 99%, 99.5% Sublimated
- Supply Ability: g-kg-tons, free sample is available
|
| | 4-FLUORO-N-ISOPROPYLANILINE Basic information |
| Product Name: | 4-FLUORO-N-ISOPROPYLANILINE | | Synonyms: | 4-FLUORO-N-ISOPROPYLANILINE;FI-Aniline;FL-ANILINE;4-Fluor-N-(1-methylethyl)-benzenamin;N-(4-Fluorophenyl)isopropylamine;N-(4-Fluorophenyl)-N-isopropylamine;4-Fluoro-N-(1-Methylethyl)benzenaMine;N-Isopropyl-4-fluoroaniline 95+% | | CAS: | 70441-63-3 | | MF: | C9H12FN | | MW: | 153.2 | | EINECS: | 448-100-7 | | Product Categories: | Amines;Aromatics;Intermediates | | Mol File: | 70441-63-3.mol |  |
| | 4-FLUORO-N-ISOPROPYLANILINE Chemical Properties |
| Boiling point | 214℃ | | density | 1.045 | | vapor pressure | 0.1-0.9Pa at 20-50℃ | | Fp | 83℃ | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 5.91±0.32(Predicted) | | InChI | InChI=1S/C9H12FN/c1-7(2)11-9-5-3-8(10)4-6-9/h3-7,11H,1-2H3 | | InChIKey | RMXBOQCXULAXBO-UHFFFAOYSA-N | | SMILES | C1(NC(C)C)=CC=C(F)C=C1 | | LogP | 2.3 at 23℃ and pH5.59 | | Surface tension | 56.68mN/m at 989.9mg/L and 20℃ | | EPA Substance Registry System | Benzenamine, 4-fluoro-N-(1-methylethyl)- (70441-63-3) |
| RIDADR | 2810 | | HazardClass | 6.1(b) | | PackingGroup | III | | HS Code | 2921490090 |
| | 4-FLUORO-N-ISOPROPYLANILINE Usage And Synthesis |
| Uses | 4-Fluoro-N-isopropylaniline is an intermediate used in the synthesis of Flufenacet, a herbicide. |
| | 4-FLUORO-N-ISOPROPYLANILINE Preparation Products And Raw materials |
|