|
|
| | alpha-Methyl-4-biphenylacetic acid Basic information |
| | alpha-Methyl-4-biphenylacetic acid Chemical Properties |
| Melting point | 168-169 °C | | Boiling point | 388.3±21.0 °C(Predicted) | | density | 1.134±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO (Slightly), Ethanol (Slightly), Methanol (Slightly, Heated) | | form | solid | | pka | 4.34±0.10(Predicted) | | color | White to off-white | | Major Application | pharmaceutical small molecule | | InChI | 1S/C15H14O2/c1-11(15(16)17)12-7-9-14(10-8-12)13-5-3-2-4-6-13/h2-11H,1H3,(H,16,17) | | InChIKey | JALUUBQFLPUJMY-UHFFFAOYSA-N | | SMILES | OC(=O)C(C)c1ccc(cc1)c2ccccc2 |
| RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | WGK 3 | | HS Code | 2916399000 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | alpha-Methyl-4-biphenylacetic acid Usage And Synthesis |
| Uses | A metabolite of Isopropylbiphenyl, a COX-2 selective inhibitor. Also an impurity of Flurbiprofen (F598700). | | Synthesis Reference(s) | Synthesis, p. 456, 1982 DOI: 10.1055/s-1982-29832 |
| | alpha-Methyl-4-biphenylacetic acid Preparation Products And Raw materials |
|