- H-L-Asp(OtBu)-OH
-
- $0.00 / 1kg
-
2026-01-17
- CAS:3057-74-7
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T+
|
| | L-Aspartic acid 4-tert-butyl ester Basic information |
| | L-Aspartic acid 4-tert-butyl ester Chemical Properties |
| Melting point | 220°C (dec.) | | Boiling point | 318.7±37.0 °C(Predicted) | | density | 1.162±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | Methanol (Slightly), Water (Slightly, Sonicated) | | form | Solid | | pka | 2.19±0.23(Predicted) | | color | White to Off-White | | Optical Rotation | [α]20/D 9±2°, c = 2% in methanol: water (4:1) | | BRN | 4671089 | | Stability: | Hygroscopic | | Major Application | peptide synthesis | | InChI | InChI=1S/C8H15NO4/c1-8(2,3)13-6(10)4-5(9)7(11)12/h5H,4,9H2,1-3H3,(H,11,12)/t5-/m0/s1 | | InChIKey | MXWMFBYWXMXRPD-YFKPBYRVSA-N | | SMILES | C(O)(=O)[C@H](CC(OC(C)(C)C)=O)N | | CAS DataBase Reference | 3057-74-7(CAS DataBase Reference) |
| | L-Aspartic acid 4-tert-butyl ester Usage And Synthesis |
| Chemical Properties | White powder | | Uses | L-Aspartic acid 4-tert-butyl ester is a protected form of L-Aspartic acid (A790024). L-Aspartic acid is a nonessential amino acid that is used to biosynthesize other amino acids within the human body. L-Aspartic acid also increases membrane conductance of mammalian neurons by voltage-dependent means, causing depolarization and nerve impulses that travel to key areas of the central nervous system. | | reaction suitability | reaction type: solution phase peptide synthesis | | Synthesis | In a 3000 mL three-necked bottle, add 1000 mL of dichloromethane, cool down to -5??C, add 344 g of anhydrous p-toluenesulfonic acid and 133 g of aspartic acid, pass through 448 g of isobutene, and maintain the reaction at -5??C for 50 hours; and then adjust the pH to 7 with a 10% aqueous solution of Na2CO3, separate the liquid, the aqueous layer was left to stand, and evaporate it under reduced pressure to produce Asp(OtBu)2, _ x000D_
Asp(OtBu) and Asp-OtBu oily mixture, the oily layer and the aqueous layer combined to be used, the yield was 58.4%. The resulting mixture was transferred to a 3000 mL three-necked flask, 125 g of CuSO4-5H2O was added, and the was adjusted with concentrated hydrochloric acid.
pH 3, stirring to raise the temperature to 40 ?? C, the reaction for 16 hours to produce Cu[Asp(OtBu)]x (x = 1 ~ 2); then reduced to room temperature, add 186.3 g
Na2EDTA-2H2O and 400mL dioxane, and adjust the pH to 8~9 with triethylamine to produce L-aspartic acid-4-tert-butyl ester. |
| | L-Aspartic acid 4-tert-butyl ester Preparation Products And Raw materials |
| Raw materials | L-Aspartic acid, 4-(1,1-dimethylethyl) 1-(phenylmethyl) ester-->N-Cbz-L-Aspartic acid 4-tert-butyl ester | | Preparation Products | L-Aspartic acid-->(2S,3S)-3-(tert-butoxycarbonyl)piperidine-2-carboxylic acid-->1,2,3-Piperidinetricarboxylic acid, 5-hydroxy-, 3-(1,1-dimethylethyl) 1,2-bis(phenylmethyl) ester, (2S,3S)--->L-Aspartic acid, N-[(phenylMethoxy)carbonyl]-L-alanyl-, 24-(1,1-diMethylethyl) ester (9CI)-->Pentanoic acid, 4-oxo-3-[[(2S)-1-oxo-2-[[(phenylMethoxy)carbonyl]aMino]propyl]aMino]-5-(2,3,5,6-tetrafluorophenoxy)-, 1,1-diMethylethyl ester, (3S)--->Butanedioic acid, bromo-, 4-(1,1-dimethylethyl) 1-methyl ester, (2S)- (9CI) |
|