- 3,5-Dimethylbenzoic acid
-
- $12.72 / 25Kg/Drum
-
2025-11-06
- CAS:499-06-9
- Min. Order: 5Kg/Drum
- Purity: 99.0%min
- Supply Ability: 60tons/month
- 3,5-Dimethylbenzoic acid
-
- $100.00 / 25kg
-
2025-08-08
- CAS:499-06-9
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 50000KG/month
|
| | 3,5-Dimethylbenzoic acid Basic information |
| Product Name: | 3,5-Dimethylbenzoic acid | | Synonyms: | 3,5-dimethyl-benzoicaci;Benzoicacid,3,5-dimethyl-;3,5-Dimethylbezoic acid;RARECHEM AL BO 0607;SYM-M-XYLYLIC ACID;M-XYLENE-5-CARBOXYLIC ACID;3,5-DIMETHYLBENZOIC ACID;3,5-Dimethylbenzoic Acid/Mesitylenic acid | | CAS: | 499-06-9 | | MF: | C9H10O2 | | MW: | 150.17 | | EINECS: | 207-876-5 | | Product Categories: | Building Blocks;C9;Carbonyl Compounds;Carboxylic Acids;Chemical Synthesis;Organic Building Blocks;intermediate;CARBOXYLICACID;Aromatic Carboxylic Acids, Amides, Anilides, Anhydrides & Salts;bc0001 | | Mol File: | 499-06-9.mol |  |
| | 3,5-Dimethylbenzoic acid Chemical Properties |
| Melting point | 169-171 °C (lit.) | | Boiling point | 271.51°C (estimate) | | density | 1.0937 (estimate) | | refractive index | 1.5188 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | form | Crystalline Powder | | pka | 4.32(at 25℃) | | color | White to light yellow | | Water Solubility | Soluble in methanol. (1 g/10 mL). Slightly soluble in water. | | BRN | 1072182 | | InChI | InChI=1S/C9H10O2/c1-6-3-7(2)5-8(4-6)9(10)11/h3-5H,1-2H3,(H,10,11) | | InChIKey | UMVOQQDNEYOJOK-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC(C)=CC(C)=C1 | | CAS DataBase Reference | 499-06-9(CAS DataBase Reference) | | NIST Chemistry Reference | Benzoic acid, 3,5-dimethyl-(499-06-9) | | EPA Substance Registry System | Benzoic acid, 3,5-dimethyl- (499-06-9) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | RTECS | DG8734030 | | Hazard Note | Irritant | | TSCA | Yes | | HS Code | 29163900 |
| | 3,5-Dimethylbenzoic acid Usage And Synthesis |
| Chemical Properties | white to light yellow crystalline powder | | Uses | 3,5-Dimethylbenzoic acid is suitable reagent used as carbon and energy supplement in the culture medium of Pseudomonas sp | | Definition | ChEBI: A dimethylbenzoic acid in which the two methyl groups are located at positions 3 and 5. | | Purification Methods | Distil the acid in steam, crystallise it from H2O (m 171.2-171.7o) or EtOH, and sublime it in vacuo.[Beilstein 9 H 536, 9 III 244, 9 IV 1806.] |
| | 3,5-Dimethylbenzoic acid Preparation Products And Raw materials |
| Raw materials | Oxygen-->Mesitylene-->Benzene, 1-(iodomethyl)-3,5-dimethyl--->3,5-Dimethylbenzaldehyde | | Preparation Products | METHOXYFENOZIDE-->3,5-Dimethylbenzoyl chloride-->Tebufenozide-->1-Iodo-3,5-dimethylbenzene-->Boron Standard Metal Solution-->METHYL 3,5-DIMETHYLBENZOATE-->4-AMINO-3,5-DIMETHYL-BENZOIC ACID METHYL ESTER-->2-bromo-3,5-dimethylbenzoic acid-->2-Amino-3,5-dimethylbenzoic acid-->1-ETHYNYL-3,5-DIMETHYL-BENZENE-->1,3,4-Thiadiazol-2-amine, 5-(3,5-dimethylphenyl)- |
|