|
|
| | 2,4,6-Trimethylbenzenesulfonic acid Basic information | | Uses |
| | 2,4,6-Trimethylbenzenesulfonic acid Chemical Properties |
| Melting point | 55-57 °C(lit.) | | density | 1.243±0.06 g/cm3(Predicted) | | Fp | >230 °F | | storage temp. | Sealed in dry,2-8°C | | pka | -0.29±0.50(Predicted) | | InChI | InChI=1S/C9H12O3S/c1-6-4-7(2)9(8(3)5-6)13(10,11)12/h4-5H,1-3H3,(H,10,11,12) | | InChIKey | LXFQSRIDYRFTJW-UHFFFAOYSA-N | | SMILES | C1(S(O)(=O)=O)=C(C)C=C(C)C=C1C | | CAS DataBase Reference | 3453-83-6(CAS DataBase Reference) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 22-26-27-36/37/39-45 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | RTECS | DB8930000 | | F | 10-21 | | HazardClass | 8 | | PackingGroup | III |
| | 2,4,6-Trimethylbenzenesulfonic acid Usage And Synthesis |
| Uses | 2-Methylsulfonyl chloride is an important organic compound. It is used in the production of methanesulfonic acid and many pharmaceutical and pesticide intermediates. |
| | 2,4,6-Trimethylbenzenesulfonic acid Preparation Products And Raw materials |
|