| Company Name: |
Reer Technology (Shanghai) Co., LTD Gold
|
| Tel: |
021-64400900 15800436310 |
| Email: |
bessey@reertech.com |
| Products Intro: |
Product Name:L-LYSINE-ALPHA-N-FMOC, EPSILON-N-T-BOC(13C6, 99%; 15N2, 99%)
CAS:850080-89-6
Purity:98% Package:0.1 G；0.25G；0.5G；1G Remarks:CNLM-4754-H-0.1
|
| Company Name: |
ChemPep, Inc.
|
| Tel: |
+1 (888) 615-9178 / (561) 791-8787 |
| Email: |
service@chempep.com |
| Products Intro: |
Product Name:Fmoc-Lys(Boc)-OH (13C6,15N2)
CAS:850080-89-6
Package:1 g, 5 g Remarks:Stable Isotope Labeled Amino Acids （Unlabeled CAS #: 71989-26-9）
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:Fmoc-Lys(Boc)-OH-13C6,15N2
CAS:850080-89-6
|
| Company Name: |
CAMBRIDGE ISOTOPE LABORATORIES INC
|
| Tel: |
978 749-8000 |
| Email: |
intlsales@isotope.com |
| Products Intro: |
Product Name:L-Lysine-α-𝑁-Fmoc, ε-𝑁-𝑡-Boc (¹³C₆, 99%; ¹⁵N₂, 99%)
CAS:850080-89-6
Purity:98% Package:g 0.0;
|
|
| | Fmoc-Lys(Boc)-OH-13C6,15N2 Basic information |
| Product Name: | Fmoc-Lys(Boc)-OH-13C6,15N2 | | Synonyms: | Fmoc-Lys(Boc)-OH-13C6,15N2;L-Lysine-13C6.15N2, α-N-Fmoc, ε-N-t-Boc;[U-13C6,U-15N2]-Fmoc-Lys(Boc)-OH;L-Lysine-13C6,15N2 (Boc), N-Fmoc;L-Lysine-1,2,3,4,5,6-13C6-N2,N6-15N2, N6-[(1,1-dimethylethoxy)carbonyl]-N2-[(9H-fluoren-9-ylmethoxy)carbonyl]-;Fmoc-Lys(Boc)-OH-13C6,15N2;N6-[(1,1-Dimethylethoxy)carbonyl]-N2-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-lysine-1,2,3,4,5,6-13C6-N2,N6-15N2;L-Lysine-α-??-Fmoc, ε-??-??-Boc (13C?, 99% | | CAS: | 850080-89-6 | | MF: | C26H32N2O6 | | MW: | 476.49 | | EINECS: | | | Product Categories: | | | Mol File: | 850080-89-6.mol |  |
| | Fmoc-Lys(Boc)-OH-13C6,15N2 Chemical Properties |
| Melting point | 130-135 °C(lit.) | | density | 1.210±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | 2-8°C | | form | solid | | InChIKey | UMRUUWFGLGNQLI-OYSAUITLSA-N | | SMILES | C(C1C2=CC=CC=C2C2=CC=CC=C12)OC(=O)[15NH][13C@H]([13C](=O)O)[13CH2][13CH2][13CH2][13CH2][15NH]C(=O)OC(C)(C)C | | CAS Number Unlabeled | 71989-26-9 |
| Hazard Codes | N | | Risk Statements | 50/53 | | Safety Statements | 60-61 | | RIDADR | UN 3077 9/PG 3 |
| | Fmoc-Lys(Boc)-OH-13C6,15N2 Usage And Synthesis |
| Uses | Fmoc-Lys(Boc)-OH(13C6,15N2) can be used to prepare peptide-based probes containing hydroaxamate amino acids for substrate selectivity and components of endogenous mammalian histone deacetylase complex. This compound can be used for assays for insulin-degrading enzyme inhibitors using IDE-binding probes for treating various diseases. |
| | Fmoc-Lys(Boc)-OH-13C6,15N2 Preparation Products And Raw materials |
|