- 4-FLUOROTHIOBENZAMIDE
-
- $0.00 / 25KG
-
2025-07-25
- CAS:22179-72-2
- Min. Order: 1KG
- Purity: 98.0%
- Supply Ability: 10000KGS
|
| | 4-FLUOROTHIOBENZAMIDE Basic information |
| | 4-FLUOROTHIOBENZAMIDE Chemical Properties |
| Melting point | 150 °C | | Boiling point | 239.5±42.0 °C(Predicted) | | density | 1.290±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator (+4°C) | | pka | 12.50±0.29(Predicted) | | Appearance | Light yellow to yellow Solid | | InChI | InChI=1S/C7H6FNS/c8-6-3-1-5(2-4-6)7(9)10/h1-4H,(H2,9,10) | | InChIKey | VQFOHZWOKJQOGO-UHFFFAOYSA-N | | SMILES | C1(C(N)=S)=CC=C(F)C=C1 | | CAS DataBase Reference | 22179-72-2(CAS DataBase Reference) |
| Provider | Language |
|
ACROS
| English |
| | 4-FLUOROTHIOBENZAMIDE Usage And Synthesis |
| Chemical Properties | Yellow crystaline powder or flakes | | Definition | ChEBI: 4-Fluoro-1-benzenecarbothioamide is an organofluorine compound. |
| | 4-FLUOROTHIOBENZAMIDE Preparation Products And Raw materials |
|