|
|
| | 2,3-Di-O-para-toluoyl-D-tartaric acid Basic information |
| | 2,3-Di-O-para-toluoyl-D-tartaric acid Chemical Properties |
| Melting point | 169-171 °C(lit.) | | alpha | 136 º (c=1, EtOH) | | Boiling point | 432.57°C (rough estimate) | | density | 1.3084 (rough estimate) | | vapor pressure | 0Pa at 25℃ | | refractive index | 139 ° (C=1, EtOH) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | DMSO (Slightly), Ethanol (Sparingly), Methanol (Slightly) | | form | Solid | | pka | 1.46±0.25(Predicted) | | color | White to Off-White | | Optical Rotation | [α]19/D +138°, c = 1 in ethanol | | Water Solubility | 112.55mg/L at 25℃ | | BRN | 3225584 | | InChI | 1S/C20H18O8/c1-11-3-7-13(8-4-11)19(25)27-15(17(21)22)16(18(23)24)28-20(26)14-9-5-12(2)6-10-14/h3-10,15-16H,1-2H3,(H,21,22)(H,23,24)/t15-,16-/m0/s1 | | InChIKey | CMIBUZBMZCBCAT-HOTGVXAUSA-N | | SMILES | Cc1ccc(cc1)C(=O)O[C@@H]([C@H](OC(=O)c2ccc(C)cc2)C(O)=O)C(O)=O | | LogP | 2.97 at 25℃ | | CAS DataBase Reference | 32634-68-7(CAS DataBase Reference) | | NIST Chemistry Reference | (+)-Di-o-4-toluoyl-d-tartaric acid(32634-68-7) | | EPA Substance Registry System | Butanedioic acid, 2,3-bis[(4-methylbenzoyl)oxy]-, (2S,3S)- (32634-68-7) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 22-24/25-36/37-26 | | WGK Germany | 3 | | F | 3-10 | | TSCA | TSCA listed | | HS Code | 29181300 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 |
| | 2,3-Di-O-para-toluoyl-D-tartaric acid Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powde | | Uses | Inhibitor of enzyme. Rivastigmine USP Related Compound A. | | Uses | blood volume expander | | Flammability and Explosibility | Not classified | | Synthesis | General procedure for the synthesis of D-(+)-di-p-toluoyltartaric acid from L-(-)-p-toluoyltartaric anhydride: 150 g of D-tartaric acid and 200 mL of toluene were added to a 1000 mL three-necked flask, and 1.5 g of copper sulfate was added as a catalyst under stirring conditions. 330 g of methylbenzoyl chloride was slowly added dropwise for a controlled period of 3 hours. After the dropwise addition, the reaction was continued for 6 hours. Upon completion of the reaction, the mixture was transferred to a centrifuge for separation. Next, 495.4 g of DP-methyldibenzoyltartaric anhydride, appropriate amount of water and toluene were added to a 2000 mL three-necked flask, heated to reflux and kept for 5 hours. At the end of the reaction, it was cooled to room temperature and 374.4 g of DP-methyldibenzoyltartaric acid was isolated. The product was used for TEM test and its structure is shown in Figure 1. The purity of the finished product D-p-methyldibenzoyltartaric acid was determined to be 99.61% with an overall yield of 96.6%. | | References | [1] Patent: CN104447338, 2016, B. Location in patent: Paragraph 0034-0036 |
| | 2,3-Di-O-para-toluoyl-D-tartaric acid Preparation Products And Raw materials |
| Raw materials | Butanedioic acid, 2,3-bis[(4-methylbenzoyl)oxy]-, (2S,3S)-, compd. with (2R)-2-(cyclopropylamino)cyclohexanol (1:1) (9CI)-->DI-(4-TOLUOYL)-L-TARTARIC ANHYDRIDE-->Toluene-->Water | | Preparation Products | CARUMONAM-->DI-(4-TOLUOYL)-L-TARTARIC ANHYDRIDE-->Butanedioic acid, 2,3-bis[(4-methylbenzoyl)oxy]-, (2S,3S)-, compd. with methyl (4S)-8-fluoro-3,4-dihydro-2-[4-(3-methoxyphenyl)-1-piperazinyl]-3-[2-methoxy-5-(trifluoromethyl)phenyl]-4-quinazolineacetate (1:1) |
|