| Company Name: |
Sichuan Kulinan Technology Co., Ltd
|
| Tel: |
400-1166-196 18981987031 |
| Email: |
cdhxsj@163.com |
| Products Intro: |
Product Name:BROMOBUTIDE
CAS:74712-19-9
Purity:99% HPLC Package:10g;50g;100g;500g;1kg;5kg;25kg
|
| Company Name: |
Hangzhou Sage Chemical Co., Ltd.
|
| Tel: |
+86057186818502 13588463833 |
| Email: |
info@sagechem.com |
| Products Intro: |
Product Name:ButanaMide, 2-broMo-3,3-diMethyl-N-(1-Methyl-1-phenylethyl)-
CAS:74712-19-9
Purity:98% Package:1g;5g;100g;Bulk
|
|
| | BROMOBUTIDE Basic information |
| Product Name: | BROMOBUTIDE | | Synonyms: | 2-bromo-3,3-dimethyl-n-(1-methyl-1-phenylethyl)-butanamid;2-bromo-3,3-dimethyl-n-(1-methyl-1-phenylethyl)butanamide;s-4347;s47;SUMIHERB;BROMOBUTIDE;Bromobutide, 10 μg /μL in cyclohexane;bromobutide (bsi, draft e-iso, draft f-iso) | | CAS: | 74712-19-9 | | MF: | C15H22BrNO | | MW: | 312.25 | | EINECS: | | | Product Categories: | | | Mol File: | 74712-19-9.mol |  |
| | BROMOBUTIDE Chemical Properties |
| Melting point | 176-177℃ | | Boiling point | 412.0±38.0 °C(Predicted) | | density | 1.209 | | storage temp. | 0-6°C | | pka | 13.81±0.46(Predicted) | | Henry's Law Constant | 1.9×102 mol/(m3Pa) at 25℃, Ebert et al. (2023) | | InChI | 1S/C15H22BrNO/c1-14(2,3)12(16)13(18)17-15(4,5)11-9-7-6-8-10-11/h6-10,12H,1-5H3,(H,17,18) | | InChIKey | WZDDLAZXUYIVMU-UHFFFAOYSA-N | | SMILES | CC(C)(C)C(Br)C(=O)NC(C)(C)c1ccccc1 |
| WGK Germany | WGK 3 | | HS Code | 29242990 | | Storage Class | 11 - Combustible Solids |
| | BROMOBUTIDE Usage And Synthesis |
| Chemical Properties | The prodrug is colorless to yellow crystal. Vapor pressure 5.92×10-2mPa(25℃).KowlgP=3.46(25℃),Henry's constant 6.53 Pa -m3/mol(calculated). Solubility in water 3.54mg/L(25℃);Solubility in other solvents(25℃ ,g/L):xylene 4.7,methanol 35,n-hexane 0.5.Stable under normal storage conditions. | | Uses | Bromobutide is a pesticide. | | Definition | ChEBI: A monocarboxylic acid amide having a 2-phenylpropan-2-yl substituent attached to the amide nitrogen and a 1-bromo-2,2-dimethylpropyl group attached to the carbonyl carbon. |
| | BROMOBUTIDE Preparation Products And Raw materials |
|