|
|
| | METHYL-5-METHOXY-2-METHYLBENZOATE Basic information | | Uses |
| Product Name: | METHYL-5-METHOXY-2-METHYLBENZOATE | | Synonyms: | METHYL-5-METHOXY-2-METHYLBENZOATE;methyl 5-hydroxy-2-methylbenzoate;5-Hydroxy-2-methyl benzoic acid methyl ester;Benzoic acid, 5-hydroxy-2-Methyl-, Methyl ester;5-Hydroxy-2-Methyl Bezoic Acid Methyl Ester;methyl 3-hydroxy-6-methylbenzoate | | CAS: | 73505-48-3 | | MF: | C9H10O3 | | MW: | 166.17 | | EINECS: | | | Product Categories: | | | Mol File: | 73505-48-3.mol |  |
| | METHYL-5-METHOXY-2-METHYLBENZOATE Chemical Properties |
| Melting point | 75-76 °C(Solv: ethyl acetate (141-78-6); ligroine (8032-32-4)) | | Boiling point | 287.9±20.0 °C(Predicted) | | density | 1.169±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | pka | 9.45±0.18(Predicted) | | form | powder | | color | Off-white | | InChI | InChI=1S/C9H10O3/c1-6-3-4-7(10)5-8(6)9(11)12-2/h3-5,10H,1-2H3 | | InChIKey | XRTIUIMAICRVLI-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C1=CC(O)=CC=C1C |
| HazardClass | IRRITANT | | HS Code | 2918290090 |
| | METHYL-5-METHOXY-2-METHYLBENZOATE Usage And Synthesis |
| Uses | Methyl 5-hydroxy-2-methylbenzoate is an important and commonly used pharmaceutical intermediate that can be used in organic synthesis and laboratory research. | | Synthesis Reference(s) | Journal of Medicinal Chemistry, 34, p. 2176, 1991 DOI: 10.1021/jm00111a038 |
| | METHYL-5-METHOXY-2-METHYLBENZOATE Preparation Products And Raw materials |
|