|
|
| | 1-Boc-Azetidine-3-yl-methanol Basic information |
| Product Name: | 1-Boc-Azetidine-3-yl-methanol | | Synonyms: | 1-Boc-3-azetidineMethanol, 95%;Boc-Azetidin-3-ylMethanol;1-(tert-Butoxycarbonyl)-3-azetidineMethanol;1-Azetidinecarboxylic acid, 3-(hydroxyMethyl)-, 1,1-diMethylethyl ester;1-Boc-3-(hydroxyMethyl)azetidine, 97+%;3-HYDROXYMETHYL-AZETIDINE-1-CARBOXYLIC ACID TERT-BUTYL ESTER;1-BOC-AZETIDINE-3-YL METHANOL;3-(Hydroxymethyl)azetidine-1-carboxylate | | CAS: | 142253-56-3 | | MF: | C9H17NO3 | | MW: | 187.24 | | EINECS: | 218-697-7 | | Product Categories: | | | Mol File: | 142253-56-3.mol |  |
| | 1-Boc-Azetidine-3-yl-methanol Chemical Properties |
| Melting point | 55 °C | | Boiling point | 268-273℃ | | density | 1.115 | | Fp | 117°(243°F) | | storage temp. | 2-8°C | | solubility | Soluble in Dimethyl sulfoxide (DMSO). | | pka | 14.82±0.10(Predicted) | | form | powder to lump | | color | White to Almost white | | InChI | InChI=1S/C9H17NO3/c1-9(2,3)13-8(12)10-4-7(5-10)6-11/h7,11H,4-6H2,1-3H3 | | InChIKey | HXRDRJKAEYHOBB-UHFFFAOYSA-N | | SMILES | N1(C(OC(C)(C)C)=O)CC(CO)C1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 23-26-37-60 | | TSCA | No | | HazardClass | IRRITANT | | HS Code | 29339900 |
| | 1-Boc-Azetidine-3-yl-methanol Usage And Synthesis |
| Description | 1-Boc-Azetidine-3-yl-methanol is a non-cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs). This compound is also a alkyl chain-based PROTAC linker that can be used in the synthesis of PROTACs. | | Chemical Properties | Clear colorless liquid | | Uses | It is an intermediate in organic syntheses |
| | 1-Boc-Azetidine-3-yl-methanol Preparation Products And Raw materials |
|