| Company Name: |
Shanghai Hanhong Scientific Co.,Ltd.
|
| Tel: |
021-54306202 13764082696 |
| Email: |
info@hanhongsci.com |
| Products Intro: |
Product Name:H-Tyr-βNA
CAS:4357-95-3
Purity:98% Remarks:021138
|
|
| | H-TYR-BETANA Basic information |
| Product Name: | H-TYR-BETANA | | Synonyms: | TYROSINE-BETANA;L-TYROSINE BETA-NAPHTHYLAMIDE;L-TYROSYL-BETA-NAPHTHYLAMIDE;H-TYR-BETANA;L-tyrosine B-naphthylamide;L-Tyrosine-?-naphthylamide;(S)-2-amino-3-(p-hydroxyphenyl)-N-(2-naphthyl)propionamide;L-TYROSINE-á-NAPHTHYLAMIDE | | CAS: | 4357-95-3 | | MF: | C19H18N2O2 | | MW: | 306.36 | | EINECS: | 2244326 | | Product Categories: | Amino Acids;I - Z;Modified Amino Acids | | Mol File: | 4357-95-3.mol |  |
| | H-TYR-BETANA Chemical Properties |
| Boiling point | 610.3±50.0 °C(Predicted) | | density | 1.296±0.06 g/cm3(Predicted) | | storage temp. | −20°C | | pka | 9.97±0.15(Predicted) | | form | powder | | color | white to off-white | | InChI | 1S/C19H18N2O2/c20-18(11-13-5-9-17(22)10-6-13)19(23)21-16-8-7-14-3-1-2-4-15(14)12-16/h1-10,12,18,22H,11,20H2,(H,21,23)/t18-/m0/s1 | | InChIKey | BZBYYTSHGRKCJJ-SFHVURJKSA-N | | SMILES | N[C@@H](Cc1ccc(O)cc1)C(=O)Nc2ccc3ccccc3c2 |
| Hazard Codes | Xn | | Risk Statements | 40 | | Safety Statements | 22-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Carc. 2 |
| | H-TYR-BETANA Usage And Synthesis |
| Uses | L-Tyrosine β-naphthylamide is a tyrosine derivative[1]. | | Definition | ChEBI: An L-tyrosine derivative that is the amide obtained by formal condensation of the carboxy group of L-tyrosine with the amino group of 2-naphthylamine. | | References | [1] Luckose F, et al. Effects of amino acid derivatives on physical, mental, and physiological activities. Crit Rev Food Sci Nutr. 2015;55(13):1793-1144. DOI:10.1080/10408398.2012.708368 |
| | H-TYR-BETANA Preparation Products And Raw materials |
|