Bis(glycinato)manganese manufacturers
- Bis(glycinato)manganese
-
- $0.00 / 1kg
-
2023-05-30
- CAS:14281-77-7
- Min. Order: 1kg
- Purity: 0.99
- Supply Ability: 500000kg
|
| | Bis(glycinato)manganese Basic information |
| Product Name: | Bis(glycinato)manganese | | Synonyms: | Bis(glycinato)manganese;Manganese chelazome;NSC 81420;manganese(2+) bis[(carboxymethyl)azanide];carboxymethylazanide,manganese(2+);Manganese(II) 2-aminoacetate;Manganese bisglycinate;L-Glveine Manganese | | CAS: | 14281-77-7 | | MF: | C4H6MnN2O4 | | MW: | 201.04 | | EINECS: | | | Product Categories: | | | Mol File: | 14281-77-7.mol |  |
| | Bis(glycinato)manganese Chemical Properties |
| InChI | InChI=1S/2C2H4NO2.Mn/c2*3-1-2(4)5;/h2*3H,1H2,(H,4,5);/q2*-1;+4/p-2 | | InChIKey | FHHFJRBVZTXHEB-UHFFFAOYSA-L | | SMILES | O=C1CN[Mn+2]2(NCC(=O)[O-]2)[O-]1 | | LogP | -1.027 (est) |
| | Bis(glycinato)manganese Usage And Synthesis |
| Uses | Manganese Bisglycinate is used as a feed additive in poultry. |
| | Bis(glycinato)manganese Preparation Products And Raw materials |
|