|
|
| | 4-Chloro-3-(trifluoromethyl)phenyl isocyanate Basic information |
| | 4-Chloro-3-(trifluoromethyl)phenyl isocyanate Chemical Properties |
| Melting point | 40-42 °C(lit.) | | Boiling point | 86-90 °C14 mm Hg(lit.) | | density | 1.4720 (estimate) | | vapor pressure | 91Pa at 20℃ | | Fp | 211 °F | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | soluble in Chloroform, Methanol | | form | Low Melting Solid, Powder or Chunks | | color | White to yellow | | Sensitive | Moisture Sensitive | | BRN | 522032 | | InChI | InChI=1S/C8H3ClF3NO/c9-7-2-1-5(13-4-14)3-6(7)8(10,11)12/h1-3H | | InChIKey | AHFPRSSHNSGRCU-UHFFFAOYSA-N | | SMILES | C1(Cl)=CC=C(N=C=O)C=C1C(F)(F)F | | CAS DataBase Reference | 327-78-6(CAS DataBase Reference) |
| | 4-Chloro-3-(trifluoromethyl)phenyl isocyanate Usage And Synthesis |
| Chemical Properties | White solid or melt | | Uses | 4-Chloro-3-(trifluoromethyl)phenyl isocyanate may be used in the synthesis of:
- N-(5′-deoxy-3′-O-tert-butyldimethylsilyl-β-D-thymidin-5′-yl)-N′-(4-chloro-3-trifluoromethylphenyl)-thiourea
- [1,3-bis(4-chloro-α,α,α-trifluoro-m-tolyl)urea]
- trans-1-(4-chloro-3-trifluoromethyl-phenyl)-3-(4-hydroxy-cyclohexyl)-urea
| | Uses | 4-Chloro-3-(trifluoromethyl)phenyl isocyanate may be used in the synthesis of:
N-(5′-deoxy-3′-O-tert-butyldimethylsilyl-β-D-thymidin-5′-yl)-N′-(4-chloro-3-trifluoromethylphenyl)-thiourea
[1,3-bis(4-chloro-α,α,α-trifluoro-m-tolyl)urea]
trans-1-(4-chloro-3-trifluoromethyl-phenyl)-3-(4-hydroxy-cyclohexyl)-urea | | General Description | 4-Chloro-3-(trifluoromethyl)phenyl isocyanate participates in an efficient methodology for the synthesis of 5-methyl-3-aryl-2-thiooxazolidin-4-ones. | | Flammability and Explosibility | Non flammable |
| | 4-Chloro-3-(trifluoromethyl)phenyl isocyanate Preparation Products And Raw materials |
|